(S)-4-benzyl-2-(quinolin-2-yl)-4,5-dihydrooxazole

Catalog Number	ACM1252576149
CAS	1252576-14-9
Structure
Synonyms	2-[(4S)-4-Benzyl-4,5-Dihydro-1,3-Oxazol-2-Yl]Quinoline; (4S)-4-benzyl-2-quinolin-2-yl-4,5-dihydro-1,3-oxazole
IUPAC Name	(4S)-4-benzyl-2-quinolin-2-yl-4,5-dihydro-1,3-oxazole
Molecular Weight	288.34
Molecular Formula	C19H16N2O
InChI	DYPJONUSIRRGAX-INIZCTEOSA-N
InChI Key	InChI=1S/C19H16N2O/c1-2-6-14(7-3-1)12-16-13-22-19(20-16)18-11-10-15-8-4-5-9-17(15)21-18/h1-11,16H,12-13H2/t16-/m0/s1
Purity	98%
Isomeric SMILES	C1[C@@H](N=C(O1)C2=NC3=CC=CC=C3C=C2)CC4=CC=CC=C4

Q&A

What is the CAS number for the compound (S)-4-benzyl-2-(quinolin-2-yl)-4,5-dihydrooxazole?

The CAS number is 1252576-14-9.

What is the molecular weight of (S)-4-benzyl-2-(quinolin-2-yl)-4,5-dihydrooxazole?

The molecular weight is 288.34.

What are some synonyms for (S)-4-benzyl-2-(quinolin-2-yl)-4,5-dihydrooxazole?

Some synonyms include (S)-4-benzyl-2-(quinolin-2-yl)-4,5-dihydrooxazole, SF140048, and Quinoline, 2-[(4S)-4,5-dihydro-4-(phenylmethyl)-2-oxazolyl].

What is the chemical formula of (S)-4-benzyl-2-(quinolin-2-yl)-4,5-dihydrooxazole?

The chemical formula is C19H16N2O.

How should (S)-4-benzyl-2-(quinolin-2-yl)-4,5-dihydrooxazole be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

Can (S)-4-benzyl-2-(quinolin-2-yl)-4,5-dihydrooxazole be stored at room temperature?

No, it should be stored at 2-8°C.

What is another name for (S)-4-benzyl-2-(quinolin-2-yl)-4,5-dihydrooxazole?

(S)-Bn-Quinox is another name for it.

What is the percentage purity of (S)-4-benzyl-2-(quinolin-2-yl)-4,5-dihydrooxazole?

The purity is 96%.

What is the storage condition requirement for (S)-4-benzyl-2-(quinolin-2-yl)-4,5-dihydrooxazole to prevent degradation?

It should be stored under inert gas to prevent degradation.

What is the molecular structure of (S)-4-benzyl-2-(quinolin-2-yl)-4,5-dihydrooxazole?

The molecular structure consists of a quinoline ring attached to a benzyl group and a dihydrooxazole ring.