(S)-3-(4-Phenyl-4,5-dihydrooxazol-2-yl)phenol

Catalog Number	ACM186584598
CAS	186584-59-8
Synonyms	4,5-Dihydro-2-(3-Hydroxyphenyl)-4(S)-Phenyloxazole; 3-[(4S)-4-Phenyl-4,5-Dihydro-1,3-Oxazol-2-Yl]Phenol
IUPAC Name	3-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol
Molecular Weight	239.27
Molecular Formula	C15H13NO2
InChI	OFLBLHDKAFLETC-CQSZACIVSA-N
InChI Key	InChI=1S/C15H13NO2/c17-13-8-4-7-12(9-13)15-16-14(10-18-15)11-5-2-1-3-6-11/h1-9,14,17H,10H2/t14-/m1/s1
Purity	98%
Isomeric SMILES	C1[C@@H](N=C(O1)C2=CC(=CC=C2)O)C3=CC=CC=C3

Q&A

What is the molecular weight of the compound (S)-3-(4-Phenyl-4,5-dihydrooxazol-2-yl)phenol?

The molecular weight of the compound is 239.27.

What are the synonyms for the compound (S)-3-(4-Phenyl-4,5-dihydrooxazol-2-yl)phenol?

The synonyms are Phenol, 3-[(4S)-4,5-dihydro-4-phenyl-2-oxazolyl]- and 3-[(4S)-4,5-Dihydro-4-phenyl-2-oxazolyl]phenol.

What is the chemical formula for the compound?

The chemical formula is C15H13NO2.

What is the predicted boiling point of the compound?

The predicted boiling point is 441.8±45.0 °C.

What is the predicted pka value of the compound?

The predicted pka value is 9.54±0.10.

What is the predicted density of the compound?

The predicted density is 1.21±0.1 g/cm3.

What is the CAS number for (S)-3-(4-Phenyl-4,5-dihydrooxazol-2-yl)phenol?

The CAS number is 186584-59-8.

How many carbon atoms are present in the compound?

There are 15 carbon atoms present in the compound.

What is the significance of the 'S' in the compound's name?

The 'S' indicates the stereochemistry of the compound.

What functional groups are present in (S)-3-(4-Phenyl-4,5-dihydrooxazol-2-yl)phenol?

The compound contains a phenol group and a phenyl group, as well as an oxazolyl group.