(S)-3-(4-Phenyl-4,5-dihydrooxazol-2-yl)benzaldehyde

Catalog Number	ACM1431287238
CAS	1431287-23-8
Synonyms	3-[(4S)-4-Phenyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde
IUPAC Name	3-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde
Molecular Weight	251.28
Molecular Formula	C16H13NO2
InChI	BJDUVUHILDMKRB-OAHLLOKOSA-N
InChI Key	InChI=1S/C16H13NO2/c18-10-12-5-4-8-14(9-12)16-17-15(11-19-16)13-6-2-1-3-7-13/h1-10,15H,11H2/t15-/m1/s1
Purity	98%
Isomeric SMILES	C1[C@@H](N=C(O1)C2=CC=CC(=C2)C=O)C3=CC=CC=C3

Q&A

What is the molecular weight of (S)-3-(4-Phenyl-4,5-dihydrooxazol-2-yl)benzaldehyde?

The molecular weight is 251.28.

What is the synonym for (S)-3-(4-Phenyl-4,5-dihydrooxazol-2-yl)benzaldehyde?

The synonym is Benzaldehyde, 3-[(4S)-4,5-dihydro-4-phenyl-2-oxazolyl]-.

What is the chemical formula or molecular formula of the compound?

The chemical formula is C16H13NO2.

What is the boiling point of (S)-3-(4-Phenyl-4,5-dihydrooxazol-2-yl)benzaldehyde?

The boiling point is 438.0±45.0 °C (Predicted).

What is the pka value of the compound?

The pka value is 3.31±0.70 (Predicted).

What is the predicted density of (S)-3-(4-Phenyl-4,5-dihydrooxazol-2-yl)benzaldehyde?

The predicted density is 1.17±0.1 g/cm3.

What is the CAS number for this compound?

The CAS number is 1431287-23-8.

How many hydrogen atoms are present in the molecule?

There are 13 hydrogen atoms present.

What functional groups are present in the compound?

The compound contains a phenyl group, a dihydrooxazol group, and a benzaldehyde group.

What is the predicted stability of the compound based on its properties?

The compound is predicted to have a moderate stability based on its boiling point, pka, and density.