(S)-2-(Isoquinolin-1-yl)-4-phenyl-4,5-dihydrooxazole

Catalog Number	ACM2058236534
CAS	2058236-53-4
Synonyms	1-[(4S)-4-Phenyl-4,5-Dihydro-2-Oxazolyl]Isoquinoline; (4S)-2-isoquinolin-1-yl-4-phenyl-4,5-dihydro-1,3-oxazole
IUPAC Name	(4S)-2-isoquinolin-1-yl-4-phenyl-4,5-dihydro-1,3-oxazole
Molecular Weight	274.32
Molecular Formula	C18H14N2O
InChI	LKMVAWVJSQQHRM-MRXNPFEDSA-N
InChI Key	InChI=1S/C18H14N2O/c1-2-7-14(8-3-1)16-12-21-18(20-16)17-15-9-5-4-6-13(15)10-11-19-17/h1-11,16H,12H2/t16-/m1/s1
Boiling Point	489.5±38.0 °C(Predicted)
Purity	97%
Isomeric SMILES	C1[C@@H](N=C(O1)C2=NC=CC3=CC=CC=C32)C4=CC=CC=C4

Q&A

What is the CAS number for (S)-2-(Isoquinolin-1-yl)-4-phenyl-4,5-dihydrooxazole?

The CAS number is 2058236-53-4.

What is the molecular weight of (S)-2-(Isoquinolin-1-yl)-4-phenyl-4,5-dihydrooxazole?

The molecular weight is 274.32.

What is another name for (S)-2-(Isoquinolin-1-yl)-4-phenyl-4,5-dihydrooxazole?

It is also known as Isoquinoline, 1-[(4S)-4,5-dihydro-4-phenyl-2-oxazolyl]- or (S)-Ph-iQuinox.

What is the molecular formula of (S)-2-(Isoquinolin-1-yl)-4-phenyl-4,5-dihydrooxazole?

The molecular formula is C18H14N2O.

What is the predicted boiling point of (S)-2-(Isoquinolin-1-yl)-4-phenyl-4,5-dihydrooxazole?

The predicted boiling point is 489.5±38.0 °C.

What is the predicted pKa value of (S)-2-(Isoquinolin-1-yl)-4-phenyl-4,5-dihydrooxazole?

The predicted pKa value is 3.59±0.30.

What is the predicted density of (S)-2-(Isoquinolin-1-yl)-4-phenyl-4,5-dihydrooxazole?

The predicted density is 1.22±0.1 g/cm3.

How many nitrogen atoms are present in the molecular formula of (S)-2-(Isoquinolin-1-yl)-4-phenyl-4,5-dihydrooxazole?

There is 1 nitrogen atom in the molecular formula.

What is the chemical structure of (S)-2-(Isoquinolin-1-yl)-4-phenyl-4,5-dihydrooxazole?

The chemical structure consists of an isoquinoline ring and a phenyl-oxazole ring.

Is (S)-2-(Isoquinolin-1-yl)-4-phenyl-4,5-dihydrooxazole a solid, liquid, or gas at room temperature?

This compound is likely a solid at room temperature based on its predicted density.