(S)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole

Catalog Number	ACM2271168319
CAS	2271168-31-9
Synonyms	(4S)-2,4,5,5-Tetraphenyl-4H-1,3-oxazole
IUPAC Name	(4S)-2,4,5,5-tetraphenyl-4H-1,3-oxazole
Molecular Weight	375.46
Molecular Formula	C27H21NO
InChI	UNNYKNMHFWMHCG-VWLOTQADSA-N
InChI Key	InChI=1S/C27H21NO/c1-5-13-21(14-6-1)25-27(23-17-9-3-10-18-23,24-19-11-4-12-20-24)29-26(28-25)22-15-7-2-8-16-22/h1-20,25H/t25-/m0/s1
Purity	98%
Isomeric SMILES	C1=CC=C(C=C1)[C@H]2C(OC(=N2)C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5

Q&A

What is the CAS number of (S)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The CAS number is 2271168-31-9.

What is the molecular weight of (S)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The molecular weight is 375.46.

What are some synonyms for (S)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

Some synonyms include Oxazole, 4,5-dihydro-2,4,5,5-tetraphenyl-, (4S)- and (4S)-4,5-Dihydro-2,4,5,5-tetraphenyloxazole.

What is the molecular formula of (S)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The molecular formula is C27H21NO.

What is the predicted boiling point of (S)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The predicted boiling point is 512.7±50.0 °C.

What is the predicted pka value of (S)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The predicted pka is 2.88±0.70.

What is the predicted density of (S)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

The predicted density is 1.10±0.1 g/cm3.

How many phenyl groups are present in the chemical structure of (S)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole?

There are four phenyl groups present.

Predicted pka value gives an idea about the acidic or basic nature of a compound. Is (S)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole expected to be acidic or basic?

(S)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole is expected to be acidic based on the predicted pka value of 2.88.

Why is (S)-2,4,5,5-Tetraphenyl-4,5-dihydrooxazole important in research or industry?

This compound may have applications in various fields such as organic synthesis, material science, or medicinal chemistry due to its unique structure and predicted properties.