What is the IUPAC Name of (S)-2-[2-[bis(2-tolyl)phosphino]phenyl]-4-tert-butyl-2-oxazoline?
[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-bis(2-methylphenyl)phosphane
How many hydrogen bond donor counts does (S)-2-[2-[bis(2-tolyl)phosphino]phenyl]-4-tert-butyl-2-oxazoline have?
It has 0 hydrogen bond donor counts.
What is the computed XLogP3 value for (S)-2-[2-[bis(2-tolyl)phosphino]phenyl]-4-tert-butyl-2-oxazoline?
The XLogP3 value is 6.6.
Are there any other synonyms or alternate names for (S)-2-[2-[bis(2-tolyl)phosphino]phenyl]-4-tert-butyl-2-oxazoline?
Yes, some other synonyms include: [2-[(4S)-4-Tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-bis(2-methylphenyl)phosphane, SCHEMBL13288309, CS-0202920, etc.
What is the molecular weight of (S)-2-[2-[bis(2-tolyl)phosphino]phenyl]-4-tert-butyl-2-oxazoline?
The molecular weight is 415.5g/mol.
How many heavy atoms are present in the chemical structure?
There are 30 heavy atoms present.
What is the Canonical SMILES for (S)-2-[2-[bis(2-tolyl)phosphino]phenyl]-4-tert-butyl-2-oxazoline?
CC1=CC=CC=C1P(C2=CC=CC=C2C)C3=CC=CC=C3C4=NC(CO4)C(C)(C)C
Do any of the atoms in the chemical structure have an undefined stereocenter count?
No, there are no undefined atom or bond stereocenters.