(S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine

Catalog Number	ACM885462884
CAS	885462-88-4
Structure
Synonyms	(1S)-2,2',3,3'-Tetrahydro-1,1'-Spirobi[1H-Indene]-7,7'-Diamine; (S)-1,1'-Spirobiindane-7,7'-Diamine
IUPAC Name	3,3'-spirobi[1,2-dihydroindene]-4,4'-diamine
Molecular Weight	250.34
Molecular Formula	C17H18N2
InChI	LXEAIMHQRXRIGO-UHFFFAOYSA-N
InChI Key	InChI=1S/C17H18N2/c18-13-5-1-3-11-7-9-17(15(11)13)10-8-12-4-2-6-14(19)16(12)17/h1-6H,7-10,18-19H2
Purity	98%+
Isomeric SMILES	C1CC2(CCC3=C2C(=CC=C3)N)C4=C1C=CC=C4N

Q&A

What is the CAS number for (S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine?

The CAS number is 885462-88-4.

What is the molecular weight of (S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine?

The molecular weight is 250.34.

What is another name for (S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine?

Another name is (S)-1,1'-Spirobiindane-7,7'-diaMine.

What is the chemical formula of (S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine?

The chemical formula is C17H18N2.

How should (S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the purity percentage of one of the synonyms of (S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine?

One synonym has a purity of 98%, with a 99% ee.

What is the stereochemistry of (S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine?

The stereochemistry is (S), meaning it is in the S configuration.

What is the storage temperature recommended for (S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine?

The recommended storage temperature is 2-8°C.

What is the full name of the chemical compound with the abbreviation (MF) C17H18N2?

The full name is (S)-1,1'-Spirobiindane-7,7'-diaMine.

Are there any other common names for (S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diamine?

Yes, some other common names include 1,1'-Spirobi[1H-indene]-7,7'-diaMine and (S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diamine.