ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(S)-1-[2-(Diphenylphosphino)phenyl]ethylamine

Catalog Number ACM913196437-1
CAS 913196-43-7
Structure {[CurrentData.Name]}
IUPAC Name (1S)-1-(2-diphenylphosphanylphenyl)ethanamine
Molecular Weight 305.35
Molecular Formula C20H20NP
InChI KPFJIPHGQGHIMM-INIZCTEOSA-N
InChI Key InChI=1S/C20H20NP/c1-16(21)19-14-8-9-15-20(19)22(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-16H,21H2,1H3/t16-/m0/s1
Boiling Point 425.8±28.0 °C(Predicted)
Melting Point 76-81 °C
Purity 98%
Isomeric SMILES C[C@@H](C1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3)N
pKa 8.73±0.10(Predicted)
Q&A

What is the IUPAC name of (S)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

The IUPAC name is (1S)-1-(2-diphenylphosphanylphenyl)ethanamine.

How many heavy atoms are present in (S)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

There are 22 heavy atoms present.

What is the exact mass of (S)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

The exact mass is 305.133336640.

How many hydrogen bond acceptor counts does (S)-1-[2-(Diphenylphosphino)phenyl]ethylamine have?

The compound has 1 hydrogen bond acceptor count.

What is the canonical SMILES representation of (S)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

CC(C1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3)N

How many rotatable bond counts does (S)-1-[2-(Diphenylphosphino)phenyl]ethylamine have?

The compound has 4 rotatable bond counts.

What is the molecular weight of (S)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

The molecular weight is 305.4g/mol.

What is the EC number of (S)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

The European Community (EC) Number is 689-675-6.

What is the CAS number of (S)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

The CAS number is 913196-43-7.

What other names are associated with (S)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

Some other names associated with (S)-1-[2-(Diphenylphosphino)phenyl]ethylamine are (S)-1-[2-(Diphenylphosphino)phenyl]ethylamine, SCHEMBL16292891, and DTXSID20726977.

Please kindly note that our products and services are for research use only.