What is the IUPAC name of (S)-(+)-1,2-Bis(diphenylphosphino)propane?
The IUPAC name of (S)-(+)-1,2-Bis(diphenylphosphino)propane is [(2S)-1-diphenylphosphanylpropan-2-yl]-diphenylphosphane.
What is the exact mass of (S)-(+)-1,2-Bis(diphenylphosphino)propane?
The exact mass of (S)-(+)-1,2-Bis(diphenylphosphino)propane is 412.15097482.
How many heavy atoms are present in (S)-(+)-1,2-Bis(diphenylphosphino)propane?
There are 29 heavy atoms present in (S)-(+)-1,2-Bis(diphenylphosphino)propane.
What is the molecular weight of (S)-(+)-1,2-Bis(diphenylphosphino)propane?
The molecular weight of (S)-(+)-1,2-Bis(diphenylphosphino)propane is 412.4 g/mol.
Does (S)-(+)-1,2-Bis(diphenylphosphino)propane have any hydrogen bond acceptor count?
No, (S)-(+)-1,2-Bis(diphenylphosphino)propane does not have any hydrogen bond acceptor count.
How many rotatable bond counts does (S)-(+)-1,2-Bis(diphenylphosphino)propane have?
The compound has 7 rotatable bond counts.
What is the Canonical SMILES of (S)-(+)-1,2-Bis(diphenylphosphino)propane?
The Canonical SMILES of (S)-(+)-1,2-Bis(diphenylphosphino)propane is CC(CP(C1=CC=CC=C1)C2=CC=CC=C2)P(C3=CC=CC=C3)C4=CC=CC=C4.
What is the CAS number of (S)-(+)-1,2-Bis(diphenylphosphino)propane?
The CAS number of (S)-(+)-1,2-Bis(diphenylphosphino)propane is 67884-33-7.
What are some of the depositor-supplied synonyms for (S)-(+)-1,2-Bis(diphenylphosphino)propane?
Some depositor-supplied synonyms for (S)-(+)-1,2-Bis(diphenylphosphino)propane include (S)-(-)-1,2-Bis(diphenylphosphino)propane and MFCD00798604.
Is (S)-(+)-1,2-Bis(diphenylphosphino)propane optically active?
Yes, (S)-(+)-1,2-Bis(diphenylphosphino)propane is optically active as it has a Defined Atom Stereocenter Count of 1.