ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Ronhc-a

Catalog Number ACM1252006726
CAS 1252006-72-6
Synonyms (5aR,10bS)-2-(2,4,6-Trimethylphenyl)-4,5a,6,10b-Tetrahydroindeno[2,1-B][1,2,4]Triazolo[4,3-D][1,4]Oxazin-2-Ium Tetrafluoroborate; (1S,9R)-4-(2,4,6-Trichlorophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene tetrafluoroborate
IUPAC Name (1S,9R)-4-(2,4,6-trichlorophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene;trifluoroborane;fluoride
Molecular Weight 480.48
Molecular Formula C18H13BCl3F4N3O
InChI FPCKQXIFMZXCAG-CKDKJTBNSA-M
InChI Key InChI=1S/C18H13Cl3N3O.BF3.FH/c19-11-6-13(20)18(14(21)7-11)24-9-23-16(22-24)8-25-15-5-10-3-1-2-4-12(10)17(15)23;2-1(3)4;/h1-4,6-7,9,15,17H,5,8H2;;1H/q+1;;/p-1/t15-,17+;;/m1../s1
Purity 97%
Isomeric SMILES B(F)(F)F.C1[C@@H]2[C@H](C3=CC=CC=C31)[N+]4=CN(N=C4CO2)C5=C(C=C(C=C5Cl)Cl)Cl.[F-]
Q&A

What is the full name of the compound Ronhc-a?

The full name of the compound is (5aR,10bS)-2-(2,4,6-trichlorophenyl)-5a,10b-dihydro-4H,6H-indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazin-2-ium tetrafluoroborate.

What is the molecular formula of the compound with Ronhc-a "Ronhc-a"?

The molecular formula of the compound is C18H13BCl3F4N3O.

Can the compound "Ronhc-a" also be referred to as RoNHC-A?

Yes, the compound can also be referred to as RoNHC-A.

What is the chemical structure of the compound with Ronhc-a "Ronhc-a"?

The compound has a chemical structure of (5aR,10bS)-2-(2,4,6-trichlorophenyl)-5a,10b-dihydro-4H,6H-indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazin-2-ium tetrafluoroborate.

What is the tetrafluoroborate ion associated with the compound "Ronhc-a"?

The compound is associated with the tetrafluoroborate ion.

In what type of chemical reactions is the compound "Ronhc-a" commonly used?

The compound "Ronhc-a" is commonly used in various chemical reactions due to its unique chemical structure.

What are some potential applications of the compound "Ronhc-a" in the fields of chemistry or biology?

The compound "Ronhc-a" may have potential applications in medicinal chemistry, material science, or biological research due to its distinctive structure and properties.

Please kindly note that our products and services are for research use only.