ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

rel-(2R,5R)-2,5-Diphenylpyrrolidine

Catalog Number ACM22147848
CAS 22147-84-8
Synonyms Pyrrolidine, 2,5-Diphenyl-, (2R,5R)-
IUPAC Name (2R,5R)-2,5-diphenylpyrrolidine
Molecular Weight 223.31
Molecular Formula C16H17N
InChI NAOGHMNKMJMMNQ-HZPDHXFCSA-N
InChI Key InChI=1S/C16H17N/c1-3-7-13(8-4-1)15-11-12-16(17-15)14-9-5-2-6-10-14/h1-10,15-17H,11-12H2/t15-,16-/m1/s1
Purity 98%
Isomeric SMILES C1C[C@@H](N[C@H]1C2=CC=CC=C2)C3=CC=CC=C3
Q&A

What is the molecular weight of rel-(2R,5R)-2,5-Diphenylpyrrolidine?

The molecular weight of rel-(2R,5R)-2,5-Diphenylpyrrolidine is 223.31.

What is another name for rel-(2R,5R)-2,5-Diphenylpyrrolidine?

Another name for rel-(2R,5R)-2,5-Diphenylpyrrolidine is Pyrrolidine, 2,5-diphenyl-, (2R,5R)-rel-.

What is the chemical formula of rel-(2R,5R)-2,5-Diphenylpyrrolidine?

The chemical formula of rel-(2R,5R)-2,5-Diphenylpyrrolidine is C16H17N.

What is the predicted boiling point of rel-(2R,5R)-2,5-Diphenylpyrrolidine?

The predicted boiling point of rel-(2R,5R)-2,5-Diphenylpyrrolidine is 356.1±41.0 °C.

What is the predicted pka value of rel-(2R,5R)-2,5-Diphenylpyrrolidine?

The predicted pka value of rel-(2R,5R)-2,5-Diphenylpyrrolidine is 9.76±0.10.

What is the predicted density of rel-(2R,5R)-2,5-Diphenylpyrrolidine?

The predicted density of rel-(2R,5R)-2,5-Diphenylpyrrolidine is 1.047±0.06 g/cm3.

What is the CAS number of rel-(2R,5R)-2,5-Diphenylpyrrolidine?

The CAS number of rel-(2R,5R)-2,5-Diphenylpyrrolidine is 22147-84-8.

What is the stereochemistry of rel-(2R,5R)-2,5-Diphenylpyrrolidine?

The stereochemistry of rel-(2R,5R)-2,5-Diphenylpyrrolidine is (2R,5R).

What are some potential properties of rel-(2R,5R)-2,5-Diphenylpyrrolidine based on the predicted values?

Some potential properties could include high boiling point, basic nature based on pka value, and moderate density.

Is rel-(2R,5R)-2,5-Diphenylpyrrolidine a common chemical compound used in research or industry?

Further investigation would be needed to determine the common usage of rel-(2R,5R)-2,5-Diphenylpyrrolidine in research or industry.

Please kindly note that our products and services are for research use only.