What is the molecular formula of (RA,S)-PH-BN-SIPHOX?
The molecular formula of (RA,S)-PH-BN-SIPHOX is C39H34NOP.
What is the molecular weight of (RA,S)-PH-BN-SIPHOX?
The molecular weight of (RA,S)-PH-BN-SIPHOX is 563.7g/mol.
How many hydrogen bond acceptors does (RA,S)-PH-BN-SIPHOX have?
(RA,S)-PH-BN-SIPHOX has 2 hydrogen bond acceptors.
What is the XLogP3 value of (RA,S)-PH-BN-SIPHOX?
The XLogP3 value of (RA,S)-PH-BN-SIPHOX is 9.
What is the Canonical SMILES representation of (RA,S)-PH-BN-SIPHOX?
The Canonical SMILES representation of (RA,S)-PH-BN-SIPHOX is C1CC2(CCC3=C2C(=CC=C3)P(C4=CC=CC=C4)C5=CC=CC=C5)C6=C1C=CC=C6C7=NC(CO7)CC8=CC=CC=C8.
What are some Depositor-Supplied Synonyms for (RA,S)-PH-BN-SIPHOX?
Some Depositor-Supplied Synonyms for (RA,S)-PH-BN-SIPHOX are 2074610-05-0 and (R)-(+)-7-[4(S)-(Benzyl)oxazol-2-yl]-7'-diphenylphosphino-2,2,3,3-tetrahydro-1,1-spirobiindane.
What is the InChIKey for (RA,S)-PH-BN-SIPHOX?
The InChIKey for (RA,S)-PH-BN-SIPHOX is WDIPXXMCRPGMIB-FZSHCYHRSA-N.
How many heavy atoms are present in (RA,S)-PH-BN-SIPHOX?
(RA,S)-PH-BN-SIPHOX contains 42 heavy atoms.
What is the Computed Properties Rotatable Bond Count for (RA,S)-PH-BN-SIPHOX?
The Computed Properties Rotatable Bond Count for (RA,S)-PH-BN-SIPHOX is 6.
What is the IUPAC Name of (RA,S)-PH-BN-SIPHOX?
The IUPAC Name of (RA,S)-PH-BN-SIPHOX is [(3S)-4-(4-benzyl-4,5-dihydro-1,3-oxazol-2-yl)-3,3'-spirobi[1,2-dihydroindene]-4'-yl]-diphenylphosphane.
