(R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine

Catalog Number	ACM86926161-1
CAS	86926-16-1
Structure
Synonyms	((1R)-1-Naphthylethyl)Dimethylamine; (1R)-N,N-dimethyl-1-naphthalen-1-ylethanamine
IUPAC Name	(1R)-N,N-dimethyl-1-naphthalen-1-ylethanamine
Molecular Weight	199.29
Molecular Formula	C14H17N
InChI	AXRXYILTIWBHEP-LLVKDONJSA-N
InChI Key	InChI=1S/C14H17N/c1-11(15(2)3)13-10-6-8-12-7-4-5-9-14(12)13/h4-11H,1-3H3/t11-/m1/s1
Purity	97%
Isomeric SMILES	C[C@H](C1=CC=CC2=CC=CC=C21)N(C)C

Q&A

What is the CAS number for (R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine?

The CAS number for (R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine is 86926-16-1.

What is the molecular weight of (R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine?

The molecular weight of (R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine is 199.29.

What is the product name of (R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine?

The product name is (R)-(+)-N,N-DIMETHYL-1-(1-NAPHTHYL)ETHYLAMINE.

What are some synonyms for (R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine?

Some synonyms are (R)-(+)-N,N-DIMETHYL-1-(1-NAPHTHYL)ETHYLAMINE and (R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine.

What is the molecular formula of (R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine?

The molecular formula is C14H17N.

What is the chemical structure of (R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine?

The chemical structure is C[C@H](C1=CC2=CC=CC=C2C=C1)N(C)C.

Is (R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine a chiral compound?

Yes, it is a chiral compound as indicated by the (R) designation in its name.

Can (R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine be used in organic synthesis?

Yes, it can be used in various organic synthesis processes due to its structure and properties.

What are some potential applications of (R)-N,N-Dimethyl-1-(naphthalen-1-yl)ethanamine?

It can be used as a building block in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals.