(R)-N,N-Dimethyl-[1,1'-binaphthalene]-2,2'-diamine

Catalog Number	ACM587838628
CAS	587838-62-8
Synonyms	[1,1'-Binaphthalene]-2,2'-diamine, N,N-dimethyl-, (1R)-
IUPAC Name	1-[2-(dimethylamino)naphthalen-1-yl]naphthalen-2-amine
Molecular Weight	312.40
Molecular Formula	C22H20N2
InChI	WJVCDEJWPSGKLR-UHFFFAOYSA-N
InChI Key	InChI=1S/C22H20N2/c1-24(2)20-14-12-16-8-4-6-10-18(16)22(20)21-17-9-5-3-7-15(17)11-13-19(21)23/h3-14H,23H2,1-2H3
Melting Point	116-118 °C
Purity	98%
Isomeric SMILES	CN(C)C1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)N

Q&A

What is the CAS number for (R)-N,N-Dimethyl-[1,1'-binaphthalene]-2,2'-diamine?

The CAS number is 587838-62-8.

What is the molecular weight of (R)-N,N-Dimethyl-[1,1'-binaphthalene]-2,2'-diamine?

The molecular weight is 312.41.

What are some synonyms for (R)-N,N-Dimethyl-[1,1'-binaphthalene]-2,2'-diamine?

Some synonyms include R-N,N-diMethyl-[1,1'-Binaphthalene]-2,2'-diaMine and (R)-N,N-Dimethyl-[1,1'-binaphthalene]-2,2'-diamine,99%e.e.

What is the chemical formula of (R)-N,N-Dimethyl-[1,1'-binaphthalene]-2,2'-diamine?

The chemical formula is C22H20N2.

What is the melting point of (R)-N,N-Dimethyl-[1,1'-binaphthalene]-2,2'-diamine?

The melting point is 116-118 °C.

What is the predicted density of (R)-N,N-Dimethyl-[1,1'-binaphthalene]-2,2'-diamine?

The predicted density is 1.186±0.06 g/cm3.

What is the predicted boiling point of (R)-N,N-Dimethyl-[1,1'-binaphthalene]-2,2'-diamine?

The predicted boiling point is 495.4±33.0 °C.

What is the predicted pKa value of (R)-N,N-Dimethyl-[1,1'-binaphthalene]-2,2'-diamine?

The predicted pKa value is 4.77±0.40.

What is the chirality of (R)-N,N-Dimethyl-[1,1'-binaphthalene]-2,2'-diamine?

The compound is in the (R) configuration.

What is the purity of one of the synonyms of (R)-N,N-Dimethyl-[1,1'-binaphthalene]-2,2'-diamine?

One of the synonyms indicates a purity of 99%.