ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(R)-(2'-Isopropoxy-[1,1'-binaphthalen]-2-yl)diphenylphosphine

Catalog Number ACM189274360-1
CAS 189274-36-0
Structure {[CurrentData.Name]}
Synonyms (R)-(+)-(Diphenylphosphino)-2'-isopropoxy-1,1'-binaphthyl
IUPAC Name diphenyl-[1-(2-propan-2-yloxynaphthalen-1-yl)naphthalen-2-yl]phosphane
Molecular Weight 496.58
Molecular Formula C35H29OP
InChI RQYTYDOSGVUKHB-UHFFFAOYSA-N
InChI Key InChI=1S/C35H29OP/c1-25(2)36-32-23-21-26-13-9-11-19-30(26)34(32)35-31-20-12-10-14-27(31)22-24-33(35)37(28-15-5-3-6-16-28)29-17-7-4-8-18-29/h3-25H,1-2H3
Purity 98%
Isomeric SMILES CC(C)OC1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)P(C5=CC=CC=C5)C6=CC=CC=C6
Q&A

What is the CAS number of the chemical structure with (R)-(2'-Isopropoxy-[1,1'-binaphthalen]-2-yl)diphenylphosphine?

The CAS number is 137769-30-3.

What is the Canonical SMILES of the chemical structure?

The Canonical SMILES is CC(C)OC1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)P(C5=CC=CC=C5)C6=CC=CC=C6.

How many heavy atoms are present in the chemical structure?

There are 37 heavy atoms present in the chemical structure.

What is the IUPAC Name of the chemical structure?

The IUPAC Name is diphenyl-[1-(2-propan-2-yloxynaphthalen-1-yl)naphthalen-2-yl]phosphane.

What is the Molecular Formula of the chemical structure?

The Molecular Formula is C35H29OP.

What is the Monoisotopic Mass of the chemical structure?

The Monoisotopic Mass is 496.195602542.

How many rotatable bonds are there in the chemical structure?

There are 6 rotatable bonds in the chemical structure.

How many hydrogen bond acceptors are present in the chemical structure?

There is 1 hydrogen bond acceptor in the chemical structure.

What is the XLogP3 of the chemical structure?

The XLogP3 is 9.5.

What are some of the other synonyms of the chemical structure?

Some of the other synonyms include (S)-(2'-Isopropoxy-[1,1'-binaphthalen]-2-yl)diphenylphosphine, Diphenyl{2'-[(propan-2-yl)oxy][1,1'-binaphthalen]-2-yl}phosphane, and SCHEMBL9224964.

Please kindly note that our products and services are for research use only.