(R)-(2'-Isopropoxy-[1,1'-binaphthalen]-2-yl)diphenylphosphine

Catalog Number	ACM189274360-1
CAS	189274-36-0
Structure
Synonyms	(R)-(+)-(Diphenylphosphino)-2'-isopropoxy-1,1'-binaphthyl
IUPAC Name	diphenyl-[1-(2-propan-2-yloxynaphthalen-1-yl)naphthalen-2-yl]phosphane
Molecular Weight	496.58
Molecular Formula	C35H29OP
InChI	RQYTYDOSGVUKHB-UHFFFAOYSA-N
InChI Key	InChI=1S/C35H29OP/c1-25(2)36-32-23-21-26-13-9-11-19-30(26)34(32)35-31-20-12-10-14-27(31)22-24-33(35)37(28-15-5-3-6-16-28)29-17-7-4-8-18-29/h3-25H,1-2H3
Purity	98%
Isomeric SMILES	CC(C)OC1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)P(C5=CC=CC=C5)C6=CC=CC=C6

Q&A

What is the CAS number of the chemical structure with (R)-(2'-Isopropoxy-[1,1'-binaphthalen]-2-yl)diphenylphosphine?

The CAS number is 137769-30-3.

What is the Canonical SMILES of the chemical structure?

The Canonical SMILES is CC(C)OC1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)P(C5=CC=CC=C5)C6=CC=CC=C6.

How many heavy atoms are present in the chemical structure?

There are 37 heavy atoms present in the chemical structure.

What is the IUPAC Name of the chemical structure?

The IUPAC Name is diphenyl-[1-(2-propan-2-yloxynaphthalen-1-yl)naphthalen-2-yl]phosphane.

What is the Molecular Formula of the chemical structure?

The Molecular Formula is C35H29OP.

What is the Monoisotopic Mass of the chemical structure?

The Monoisotopic Mass is 496.195602542.

How many rotatable bonds are there in the chemical structure?

There are 6 rotatable bonds in the chemical structure.

How many hydrogen bond acceptors are present in the chemical structure?

There is 1 hydrogen bond acceptor in the chemical structure.

What is the XLogP3 of the chemical structure?

The XLogP3 is 9.5.

What are some of the other synonyms of the chemical structure?

Some of the other synonyms include (S)-(2'-Isopropoxy-[1,1'-binaphthalen]-2-yl)diphenylphosphine, Diphenyl{2'-[(propan-2-yl)oxy][1,1'-binaphthalen]-2-yl}phosphane, and SCHEMBL9224964.