(R)-2-(6-Methylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole

Catalog Number	ACM199277731
CAS	199277-73-1
Structure
Synonyms	Pyridine, 2-[(4R)-4,5-dihydro-4-phenyl-2-oxazolyl]-6-methyl-
IUPAC Name	2-(6-methylpyridin-2-yl)-4-phenyl-4,5-dihydro-1,3-oxazole
Molecular Weight	238.28
Molecular Formula	C15H14N2O
InChI	ZBYAUOZWGYIGNW-UHFFFAOYSA-N
InChI Key	InChI=1S/C15H14N2O/c1-11-6-5-9-13(16-11)15-17-14(10-18-15)12-7-3-2-4-8-12/h2-9,14H,10H2,1H3
Purity	97%
Isomeric SMILES	CC1=NC(=CC=C1)C2=NC(CO2)C3=CC=CC=C3

Q&A

What is the CAS number for the compound with (R)-2-(6-Methylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole?

The CAS number for the compound is 199277-73-1.

What is the molecular weight of the compound with (R)-2-(6-Methylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole?

The molecular weight of the compound is 238.28 g/mol.

What is the product name of the compound with (R)-2-(6-Methylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole?

The product name is Pyridine, 2-[(4R)-4,5-dihydro-4-phenyl-2-oxazolyl]-6-methyl-.

What are some synonyms for the compound with (R)-2-(6-Methylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole?

Some synonyms for the compound are (R)-2-(6-Methylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole and 2-[(4R)-4,5-dihydro-4-phenyl-2-oxazolyl]-6-methyl-Pyridine.

What is the molecular formula of the compound with (R)-2-(6-Methylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole?

The molecular formula is C15H14N2O.

What is the predicted boiling point of the compound with (R)-2-(6-Methylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole?

The predicted boiling point is 407.1±45.0 °C.

What is the predicted pka value of the compound with (R)-2-(6-Methylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole?

The predicted pka value is 3.83±0.19.

What is the predicted density of the compound with (R)-2-(6-Methylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole?

The predicted density is 1.17±0.1 g/cm3.