What is the molecular formula of (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl?
The molecular formula is C44H32P2.
What is the UNII number for (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl?
The UNII number is 4F1X2F8NA3, OX12238KWH, and 970O8508MB.
What is the CAS number for (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl?
The CAS numbers are 98327-87-8, 76189-56-5, and 76189-55-4.
What is the Canonical SMILES notation for (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl?
The Canonical SMILES is C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=CC=C7)C8=CC=CC=C8.
How many heavy atoms are present in (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl?
There are 46 heavy atoms in (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl.
What is the XLogP3 value for (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl?
The XLogP3 value is 11.4.
What are some other names or synonyms for (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl?
Some other synonyms include BINAP, (S)-(-)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl, (S)-BINAP, and many more.
How many computed properties does (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl have?
There are various computed properties listed, such as Complexity, Covalently-Bonded Unit Count, Defined Atom Stereocenter Count, etc.