What is the CAS number for 2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl?
CAS numbers are 153305-67-0, 100165-88-6, 99646-28-3
Does 2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl contain any hydrogen bond acceptor or donor counts?
No, it does not contain any hydrogen bond acceptor or donor counts.
How many heavy atoms are present in the molecular formula of 2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl?
There are 50 heavy atoms.
What is the molecular weight of 2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl?
The molecular weight is 678.8 g/mol.
How many rotatable bonds does 2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl have?
There are 7 rotatable bonds.
What is the Canonical SMILES representation of 2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl?
The Canonical SMILES representation is CC1=CC=C(C=C1)P(C2=CC=C(C=C2)C)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=C(C=C7)C)C8=CC=C(C=C8)C
What is the IUPAC name of 2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl?
The IUPAC name is [1-[2-bis(4-methylphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis(4-methylphenyl)phosphane
How many covalently-bonded unit counts are there in 2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl?
There is 1 covalently-bonded unit count.
What is the XLogP3 value of 2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl?
The XLogP3 value is 12.9.