ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene

Catalog Number ACM1221745909-1
CAS 1221745-90-9
Molecular Weight 502.35
Molecular Formula C28H32FeOP2
Purity 98%
Appearance Orange powder
Type JoSPOphos
Q&A

What is the molecular weight of (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?

The molecular weight is 511.4g/mol.

How many heavy atoms are present in (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?

There are 32 heavy atoms in (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene.

What is the exact mass of (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?

The exact mass is 511.198200.

How many rotatable bonds are present in (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?

There are 6 rotatable bonds present.

What is the Canonical SMILES of (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?

CC(C1CCCC1[P+](=O)C(C)(C)C)P(C2=CC=CC=C2)C3=CC=CC=C3.C1CCCC1.[Fe]

How many Covalently-Bonded Unit Counts are there?

There are 3 Covalently-Bonded Unit Counts.

How many Undefined Atom Stereocenter Counts are present?

There are 3 Undefined Atom Stereocenter Counts.

What is the IUPAC Name of (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?

tert-butyl-[2-(1-diphenylphosphanylethyl)cyclopentyl]-oxophosphanium;cyclopentane;iron

What is the InChIKey of (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?

BAWKDLLSWCINJI-UHFFFAOYSA-N

How many Hydrogen Bond Acceptor Counts are present?

There is 1 Hydrogen Bond Acceptor Count.

Please kindly note that our products and services are for research use only.