What is the molecular weight of (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?
The molecular weight is 511.4g/mol.
How many heavy atoms are present in (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?
There are 32 heavy atoms in (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene.
What is the exact mass of (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?
The exact mass is 511.198200.
How many rotatable bonds are present in (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?
There are 6 rotatable bonds present.
What is the Canonical SMILES of (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?
CC(C1CCCC1[P+](=O)C(C)(C)C)P(C2=CC=CC=C2)C3=CC=CC=C3.C1CCCC1.[Fe]
How many Covalently-Bonded Unit Counts are there?
There are 3 Covalently-Bonded Unit Counts.
How many Undefined Atom Stereocenter Counts are present?
There are 3 Undefined Atom Stereocenter Counts.
What is the IUPAC Name of (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?
tert-butyl-[2-(1-diphenylphosphanylethyl)cyclopentyl]-oxophosphanium;cyclopentane;iron
What is the InChIKey of (R)-1-[(R)-tert-Butylphosphinoyl]-2-[(R)-1-(diphenylphosphino)ethyl]ferrocene?
BAWKDLLSWCINJI-UHFFFAOYSA-N
How many Hydrogen Bond Acceptor Counts are present?
There is 1 Hydrogen Bond Acceptor Count.