What is the molecular formula of (R)-1-(Diphenylphosphino)-2-amino-3-methylbutane?
The molecular formula is C17H22NP.
What is the exact mass of (R)-1-(Diphenylphosphino)-2-amino-3-methylbutane?
The exact mass is 271.148986704 g/mol.
What is the IUPAC name of (R)-1-(Diphenylphosphino)-2-amino-3-methylbutane?
The IUPAC name is (2R)-1-diphenylphosphanyl-3-methylbutan-2-amine.
How many heavy atoms are present in (R)-1-(Diphenylphosphino)-2-amino-3-methylbutane?
There are 19 heavy atoms.
How many rotatable bonds does (R)-1-(Diphenylphosphino)-2-amino-3-methylbutane have?
(R)-1-(Diphenylphosphino)-2-amino-3-methylbutane has 5 rotatable bonds.
What is the topological polar surface area of (R)-1-(Diphenylphosphino)-2-amino-3-methylbutane?
The topological polar surface area is 26.
What is the XLogP3 value of (R)-1-(Diphenylphosphino)-2-amino-3-methylbutane?
The XLogP3 value is 3.5.
What is the canonical SMILES representation of (R)-1-(Diphenylphosphino)-2-amino-3-methylbutane?
CC(C)C(CP(C1=CC=CC=C1)C2=CC=CC=C2)N
What is the InChIKey of (R)-1-(Diphenylphosphino)-2-amino-3-methylbutane?
The InChIKey is ZZLCXURCZWQECA-KRWDZBQOSA-N.
What is another name used for (R)-1-(Diphenylphosphino)-2-amino-3-methylbutane?
Another name used for (R)-1-(Diphenylphosphino)-2-amino-3-methylbutane is (R)-1-(Diph enylphosphino)-3-methyl-2-butylamine.
