(R)-1-[2-(Diphenylphosphino)phenyl]ethylamine

Catalog Number	ACM192057606-1
CAS	192057-60-6
Structure
Synonyms	(R)-(+)-1-[2-(Diphenylphosphino)Phenyl]Ethylamine
IUPAC Name	(1R)-1-(2-diphenylphosphanylphenyl)ethanamine
Molecular Weight	305.35
Molecular Formula	C20H20NP
Canonical SMILES	CC(C1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3)N
InChI	KPFJIPHGQGHIMM-MRXNPFEDSA-N
InChI Key	InChI=1S/C20H20NP/c1-16(21)19-14-8-9-15-20(19)22(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-16H,21H2,1H3/t16-/m1/s1
Boiling Point	425.8±28.0 °C(Predicted)
Melting Point	75-81 °C
Purity	98%
Appearance	Solid
Exact Mass	305.13300
Isomeric SMILES	C[C@H](C1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3)N
pKa	8.73±0.10(Predicted)

Q&A

What is the CAS number for the compound (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

The CAS number is 192057-60-6.

How many heavy atoms are present in the molecular formula of (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

There are 22 heavy atoms.

What is the IUPAC name of (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

The IUPAC name is (1R)-1-(2-diphenylphosphanylphenyl)ethanamine.

How many hydrogen bond acceptors are there in (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

There is 1 hydrogen bond acceptor.

What is the exact mass of (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

The exact mass is 305.133336640.

What is the molecular weight of (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

The molecular weight is 305.4 g/mol.

What is the canonical SMILES representation of (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

The Canonical SMILES is CC(C1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3)N.

How many rotatable bonds are present in (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

There are 4 rotatable bonds.

What is the XLogP3 value of (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

The XLogP3 value is 3.9.

What is the InChIKey for (R)-1-[2-(Diphenylphosphino)phenyl]ethylamine?

The InChIKey is KPFJIPHGQGHIMM-MRXNPFEDSA-N.