What is the CAS number of R-(+)-1,2-Bis(diphenylphosphino)propane?
CAS number of R-(+)-1,2-Bis(diphenylphosphino)propane is 67884-32-6.
What is the molecular weight of R-(+)-1,2-Bis(diphenylphosphino)propane?
The molecular weight of R-(+)-1,2-Bis(diphenylphosphino)propane is 412.4g/mol.
What is the IUPAC Name of R-(+)-1,2-Bis(diphenylphosphino)propane?
The IUPAC Name of R-(+)-1,2-Bis(diphenylphosphino)propane is [(2R)-1-diphenylphosphanylpropan-2-yl]-diphenylphosphane.
How many heavy atoms are present in R-(+)-1,2-Bis(diphenylphosphino)propane?
There are 29 heavy atoms present in R-(+)-1,2-Bis(diphenylphosphino)propane.
What is the Canonical SMILES of R-(+)-1,2-Bis(diphenylphosphino)propane?
The Canonical SMILES of R-(+)-1,2-Bis(diphenylphosphino)propane is CC(CP(C1=CC=CC=C1)C2=CC=CC=C2)P(C3=CC=CC=C3)C4=CC=CC=C4.
How many hydrogen bond acceptor counts are there in R-(+)-1,2-Bis(diphenylphosphino)propane?
There are 0 hydrogen bond acceptor counts in R-(+)-1,2-Bis(diphenylphosphino)propane.
What is the XLogP3 value of R-(+)-1,2-Bis(diphenylphosphino)propane?
The XLogP3 value of R-(+)-1,2-Bis(diphenylphosphino)propane is 6.3.
What is the InChIKey of R-(+)-1,2-Bis(diphenylphosphino)propane?
The InChIKey of R-(+)-1,2-Bis(diphenylphosphino)propane is WGOBPPNNYVSJTE-HSZRJFAPSA-N.
Provide one of the Depositor-Supplied Synonyms of R-(+)-1,2-Bis(diphenylphosphino)propane.
One of the Depositor-Supplied Synonyms is (R)-PROPHOS.
What is the exact mass of R-(+)-1,2-Bis(diphenylphosphino)propane?
The exact mass of R-(+)-1,2-Bis(diphenylphosphino)propane is 412.15097482.