ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(R)-[1,1'-Binaphthalene]-4,4'-diamine

Catalog Number ACM64235434
CAS 64235-43-4
IUPAC Name 4-(4-aminonaphthalen-1-yl)naphthalen-1-amine
Molecular Weight 284.35
Molecular Formula C20H16N2
InChI RZPBZEISZUFQSV-UHFFFAOYSA-N
InChI Key InChI=1S/C20H16N2/c21-19-11-9-15(13-5-1-3-7-17(13)19)16-10-12-20(22)18-8-4-2-6-14(16)18/h1-12H,21-22H2
Purity 97%
Isomeric SMILES C1=CC=C2C(=C1)C(=CC=C2N)C3=CC=C(C4=CC=CC=C43)N
Q&A

What is the CAS number of (R)-[1,1'-Binaphthalene]-4,4'-diamine?

The CAS number of (R)-[1,1'-Binaphthalene]-4,4'-diamine is 64235-43-4.

What is the molecular weight of (R)-[1,1'-Binaphthalene]-4,4'-diamine?

The molecular weight of (R)-[1,1'-Binaphthalene]-4,4'-diamine is 284.36.

What is the product name of (R)-[1,1'-Binaphthalene]-4,4'-diamine?

The product name of (R)-[1,1'-Binaphthalene]-4,4'-diamine is [1,1'-Binaphthalene]-4,4'-diamine, (R)- (9CI).

What is the synonym for (R)-[1,1'-Binaphthalene]-4,4'-diamine?

A synonym for (R)-[1,1'-Binaphthalene]-4,4'-diamine is (R)-[1,1'-Binaphthalene]-4,4'-diamine.

What is the molecular formula of (R)-[1,1'-Binaphthalene]-4,4'-diamine?

The molecular formula of (R)-[1,1'-Binaphthalene]-4,4'-diamine is C20H16N2.

What is the predicted boiling point of (R)-[1,1'-Binaphthalene]-4,4'-diamine?

The predicted boiling point of (R)-[1,1'-Binaphthalene]-4,4'-diamine is 476.9±40.0 °C.

What is the predicted pka value of (R)-[1,1'-Binaphthalene]-4,4'-diamine?

The predicted pka value of (R)-[1,1'-Binaphthalene]-4,4'-diamine is 4.21±0.10.

What is the predicted density of (R)-[1,1'-Binaphthalene]-4,4'-diamine?

The predicted density of (R)-[1,1'-Binaphthalene]-4,4'-diamine is 1.249±0.06 g/cm3.

What is the stereochemistry of (R)-[1,1'-Binaphthalene]-4,4'-diamine?

The compound has the stereochemistry (R)-.

Please kindly note that our products and services are for research use only.