3-Pyridin-2-yl-benzoic acid

Catalog Number	ACM4467076-1
CAS	4467-07-6
Structure
Synonyms	3-(2-Pyridyl)Benzoic Acid
IUPAC Name	3-pyridin-2-ylbenzoic acid
Molecular Weight	199.21
Molecular Formula	C12H9NO2
InChI	IRXFQXMHMRTLIR-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H9NO2/c14-12(15)10-5-3-4-9(8-10)11-6-1-2-7-13-11/h1-8H,(H,14,15)
Melting Point	207 °C
Purity	98%
Isomeric SMILES	C1=CC=NC(=C1)C2=CC(=CC=C2)C(=O)O

Q&A

What is the molecular weight of 3-Pyridin-2-yl-benzoic acid?

The molecular weight of 3-Pyridin-2-yl-benzoic acid is 199.21.

What are the product categories that 3-Pyridin-2-yl-benzoic acid belongs to?

3-Pyridin-2-yl-benzoic acid belongs to API intermediates product categories.

What is the synonym for 3-Pyridin-2-yl-benzoic acid?

The synonym for 3-Pyridin-2-yl-benzoic acid is 3-(2-pyridinyl)benzoate.

What is the melting point of 3-Pyridin-2-yl-benzoic acid?

The melting point of 3-Pyridin-2-yl-benzoic acid is 207°C.

What is the density of 3-Pyridin-2-yl-benzoic acid?

The density of 3-Pyridin-2-yl-benzoic acid is predicted to be 1.241±0.06 g/cm3.

What is the color of 3-Pyridin-2-yl-benzoic acid?

3-Pyridin-2-yl-benzoic acid is off-white in color.

What is the predicted boiling point of 3-Pyridin-2-yl-benzoic acid?

The predicted boiling point of 3-Pyridin-2-yl-benzoic acid is 409.0±28.0°C.

How should 3-Pyridin-2-yl-benzoic acid be stored?

3-Pyridin-2-yl-benzoic acid should be sealed in dry storage at room temperature.

What is the predicted pka value of 3-Pyridin-2-yl-benzoic acid?

The predicted pka value of 3-Pyridin-2-yl-benzoic acid is 3.49±0.10.

What is the Hazard Code associated with 3-Pyridin-2-yl-benzoic acid?

The Hazard Code for 3-Pyridin-2-yl-benzoic acid is Xn.