Pyridin-1-ium trifluoromethanesulfonate

Catalog Number	ACM52193541-1
CAS	52193-54-1
Structure
Synonyms	Pyridinium triflate
IUPAC Name	pyridin-1-ium;trifluoromethanesulfonate
Molecular Weight	229.18
Molecular Formula	C6H6F3NO3S
InChI	YWVYZMVYXAVAKS-UHFFFAOYSA-N
InChI Key	InChI=1S/C5H5N.CHF3O3S/c1-2-4-6-5-3-1;2-1(3,4)8(5,6)7/h1-5H;(H,5,6,7)
Melting Point	221-223 °C-lit.
Purity	98%
Appearance	Solid
Isomeric SMILES	C1=CC=[NH+]C=C1.C(F)(F)(F)S(=O)(=O)[O-]

Q&A

What is the molecular weight of Pyridinium trifluoromethanesulfonate?

The molecular weight of Pyridinium trifluoromethanesulfonate is 229.17.

What are the product categories that Pyridinium trifluoromethanesulfonate falls under?

Pyridinium Compounds and organic triflate compounds.

What is the melting point of Pyridinium trifluoromethanesulfonate?

The melting point of Pyridinium trifluoromethanesulfonate is 221-223 °C.

In what form does Pyridinium trifluoromethanesulfonate come in?

It comes in powder form.

How is Pyridinium trifluoromethanesulfonate stored?

It is stored under inert gas (nitrogen or argon) at 2-8°C.

Is Pyridinium trifluoromethanesulfonate soluble in water?

Yes, it is miscible with water and soluble in polar solvents.

What is the InChIKey for Pyridinium trifluoromethanesulfonate?

The InChIKey is YWVYZMVYXAVAKS-UHFFFAOYSA-N.

What are the hazard codes associated with Pyridinium trifluoromethanesulfonate?

The hazard codes are Xn.

What are the uses of Pyridinium trifluoromethanesulfonate?

Pyridinium trifluoromethanesulfonate is used as a catalyst for various reactions such as condensation of alcohols and carboxylic acids, reaction of aromatic compounds with sulfonyl chlorides, and more.

How is Pyridinium trifluoromethanesulfonate used in conjunction with silylbenzamide?

Catalytic amounts of Pyridinium trifluoromethanesulfonate in conjunction with silylbenzamide is a versatile reagent for the silylation of alcohols.