Potassium di-tert-butylphosphate

Catalog Number	ACM33494803-1
CAS	33494-80-3
Structure
Synonyms	Di-tert-butylphosphate potassium salt; Potassium;ditert-butyl phosphate
IUPAC Name	potassium;ditert-butyl phosphate
Molecular Weight	248.30
Molecular Formula	C8H18KO4P
InChI	ZSWXMOQFFWMZQH-UHFFFAOYSA-M
InChI Key	InChI=1S/C8H19O4P.K/c1-7(2,3)11-13(9,10)12-8(4,5)6;/h1-6H3,(H,9,10);/q;+1/p-1
Melting Point	247-252 °C
Purity	95%+
Appearance	Solid
Isomeric SMILES	CC(C)(C)OP(=O)([O-])OC(C)(C)C.[K+]

Q&A

What is the molecular weight of potassium di-tert-butylphosphate?

The molecular weight of potassium di-tert-butylphosphate is 248.30g/mol.

What is the IUPAC name of potassium di-tert-butylphosphate?

The IUPAC name of potassium di-tert-butylphosphate is potassium;ditert-butyl phosphate.

What is the InChIKey of potassium di-tert-butylphosphate?

The InChIKey of potassium di-tert-butylphosphate is ZSWXMOQFFWMZQH-UHFFFAOYSA-M.

What is the CAS number of potassium di-tert-butylphosphate?

The CAS number of potassium di-tert-butylphosphate is 33494-80-3.

What is the canonical SMILES of potassium di-tert-butylphosphate?

The canonical SMILES of potassium di-tert-butylphosphate is CC(C)(C)OP(=O)([O-])OC(C)(C)C.[K+]

How many covalently-bonded units are found in potassium di-tert-butylphosphate?

There are 2 covalently-bonded units in potassium di-tert-butylphosphate.

How many heavy atoms are present in potassium di-tert-butylphosphate?

There are 14 heavy atoms in potassium di-tert-butylphosphate.