| Catalog Number |
ACM31248392-5 |
| CAS |
31248-39-2 |
| Structure |
 |
| Description |
PtOEP is an oxygen-quenchable luminescent dye. |
| Synonyms |
2,3,7,8,12,13,17,18-Octaethylporphyrin-22,24-diide;platinum(2+) |
| IUPAC Name |
2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide;platinum(2+) |
| Molecular Weight |
727.8 |
| Molecular Formula |
C36H44N4Pt |
| Canonical SMILES |
CCC1=C(C2=CC3=NC(=CC4=C(C(=C([N-]4)C=C5C(=C(C(=N5)C=C1[N-]2)CC)CC)CC)CC)C(=C3CC)CC)CC.[Pt+2] |
| InChI |
InChI=1S/C36H44N4.Pt/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20H,9-16H2,1-8H3;/q-2;+2 |
| InChI Key |
WAODGUVBNLMTSF-UHFFFAOYSA-N |
| Melting Point |
>300 °C |
| Purity |
95%+ |
| Application |
Platinum octaethylporphyrin (PtOEP) may be used as a fluorescent dye in the fabrication of polymer- and silica-based oxygen sensors. It is used as a red triplet emitting material with high external quantum yields for OLEDs. PtOEP is used as a dopant in host materials like CBP and Alq3. Its red emission is near 650 nm depending on host material and processing conditions. |
| Storage |
room temp |
| Complexity |
1150 |
| Covalently-Bonded Unit Count |
2 |
| Exact Mass |
727.321392 |
| Formal Charge |
0 |
| Heavy Atom Count |
41 |
| Hydrogen Bond Acceptor Count |
4 |
| Hydrogen Bond Donor Count |
0 |
| MDL Number |
MFCD00672301 |
| Monoisotopic Mass |
727.321392 |
| Rotatable Bond Count |
8 |
| Topological Polar Surface Area |
26.7 Ų |
