Platinum(II)-ammonium chloride

Catalog Number	ACM13820412-4
CAS	13820-41-2
Structure
Synonyms	Ammoniumchloroplatinate(II)
IUPAC Name	diazanium;tetrachloroplatinum(2-)
Molecular Weight	373
Molecular Formula	N2H8PtCl4
Canonical SMILES	[NH4+].[NH4+].Cl[Pt-2](Cl)(Cl)Cl
InChI	InChI=1S/4ClH.2H3N.Pt/h4*1H;2*1H3;/q;+2/p-2
InChI Key	QJIMNDWDOXTTBR-UHFFFAOYSA-L
Melting Point	1240 °C
Purity	98%
Appearance	Light brown crystal
Complexity	19.1
Covalently-Bonded Unit Count	3
Defined Atom Stereocenter Count	0
EC Number	237-499-1
Exact Mass	372.906003
Formal Charge	0
Heavy Atom Count	7
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	2
Monoisotopic Mass	370.908953
Rotatable Bond Count	0
Topological Polar Surface Area	2 Ų

Q&A

What is the molecular weight of Platinum(II)-ammonium chloride?

The molecular weight of Platinum(II)-ammonium chloride is 354.92.

In what product categories can Platinum(II)-ammonium chloride be found?

Platinum(II)-ammonium chloride can be found in halometallate salt, chemical reaction, pharm, electronic, and materials product categories.

What is the color of Platinum(II)-ammonium chloride?

The color of Platinum(II)-ammonium chloride is pink.

What is the specific gravity of Platinum(II)-ammonium chloride?

The specific gravity of Platinum(II)-ammonium chloride is 2.936.

What are the exposure limits for Platinum(II)-ammonium chloride according to ACGIH and NIOSH?

ACGIH exposure limit for Platinum(II)-ammonium chloride is TWA 0.002 mg/m3 and NIOSH exposure limit is IDLH 4 mg/m3; TWA 0.002 mg/m3.

What is the solubility of Platinum(II)-ammonium chloride in water?

Platinum(II)-ammonium chloride is soluble in water.

What is the hazard code associated with Platinum(II)-ammonium chloride?

The hazard code associated with Platinum(II)-ammonium chloride is T.

How should Platinum(II)-ammonium chloride be stored?

Platinum(II)-ammonium chloride should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What are the safety statements associated with Platinum(II)-ammonium chloride?

The safety statements associated with Platinum(II)-ammonium chloride are 22-26-36/37/39-45.

What are the potential exposures and uses of Platinum(II)-ammonium chloride?

Platinum(II)-ammonium chloride is used in photography and as a spectral analysis standard. It is also used in the preparation of platinum sponge and platinum catalytic agent.