Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester

Catalog Number	ACM145650608
CAS	145650-60-8
Synonyms	Bis(2,4-Ditert-Butyl-6-Methylphenyl) Ethyl Phosphite
IUPAC Name	bis(2,4-ditert-butyl-6-methylphenyl) ethyl phosphite
Molecular Weight	514.72
Molecular Formula	C32H51O3P
InChI	ZEFSGHVBJCEKAZ-UHFFFAOYSA-N
InChI Key	InChI=1S/C32H51O3P/c1-16-33-36(34-27-21(2)17-23(29(4,5)6)19-25(27)31(10,11)12)35-28-22(3)18-24(30(7,8)9)20-26(28)32(13,14)15/h17-20H,16H2,1-15H3
Boiling Point	497.4±45.0 °C(Predicted)
Isomeric SMILES	CCOP(OC1=C(C=C(C=C1C)C(C)(C)C)C(C)(C)C)OC2=C(C=C(C=C2C)C(C)(C)C)C(C)(C)C

Q&A

What is the CAS number of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester?

The CAS number of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester is 145650-60-8.

What is the molecular formula of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester?

The molecular formula of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester is C32H51O3P.

How many hydrogen bond acceptors are in Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester?

There are 3 hydrogen bond acceptors in Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester.

How many rotatable bonds are in Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester?

There are 10 rotatable bonds in Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester.

What is the XLogP3 value of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester?

The XLogP3 value of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester is 11.5.

What is the exact mass of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester?

The exact mass of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester is 514.35758248.

What is the IUPAC name of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester?

The IUPAC name of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester is bis(2,4-ditert-butyl-6-methylphenyl) ethyl phosphite.

What is the InChIKey of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester?

The InChIKey of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester is ZEFSGHVBJCEKAZ-UHFFFAOYSA-N.

What is the molecular weight of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester?

The molecular weight of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester is 514.7g/mol.

What are some of the synonyms of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester?

Some of the synonyms of Phosphorous acid, bis[2,4-bis(1,1-dimethylethyl)-6-methylphenyl] ethyl ester are IRGAFOS 38, BIS(2,4-DI-TERT-BUTYL-6-METHYL PHENYL)ETHYL PHOSPHITE, and FT-0774974.