Phospholane 1-oxide

Catalog Number	ACM48082311
CAS	48082-31-1
Synonyms	Phospholan-1-ium 1-oxide
IUPAC Name	phospholan-1-ium 1-oxide
Molecular Weight	104.09
Molecular Formula	C4H9OP
InChI	FMXSEXLKXMOCJO-UHFFFAOYSA-N
InChI Key	InChI=1S/C4H8OP/c5-6-3-1-2-4-6/h1-4H2/q+1
Purity	98%
Isomeric SMILES	C1CC[P+](=O)C1

Q&A

What is the molecular formula of Phospholane 1-oxide?

The molecular formula of Phospholane 1-oxide is C11H12F3OP.

What is the IUPAC name of Phospholane 1-oxide?

The IUPAC name of Phospholane 1-oxide is 1-[4-(trifluoromethyl)phenyl]-1λ5-phospholane 1-oxide.

What is the exact mass of Phospholane 1-oxide?

The exact mass of Phospholane 1-oxide is 248.05778649.

How many heavy atoms are present in Phospholane 1-oxide?

There are 16 heavy atoms present in Phospholane 1-oxide.

What is the topological polar surface area of Phospholane 1-oxide?

The topological polar surface area of Phospholane 1-oxide is 17.1.

How many hydrogen bond acceptors are there in Phospholane 1-oxide?

There are 4 hydrogen bond acceptors in Phospholane 1-oxide.

How many rotatable bonds are present in Phospholane 1-oxide?

There is 1 rotatable bond present in Phospholane 1-oxide.

What is the canonical SMILES of Phospholane 1-oxide?

The canonical SMILES of Phospholane 1-oxide is C1CCP(=O)(C1)C2=CC=C(C=C2)C(F)(F)F.

What is the InChIKey of Phospholane 1-oxide?

The InChIKey of Phospholane 1-oxide is KUISSGINIHXRCG-UHFFFAOYSA-N.

What are some of the depositor-supplied synonyms for Phospholane 1-oxide?

Some depositor-supplied synonyms for Phospholane 1-oxide are CHEMBL4642014, SCHEMBL16053538, and AKOS037478157.