Phosphinic acid, (diethoxymethyl)-, ethyl ester

Catalog Number	ACM65600740-1
CAS	65600-74-0
Structure
Synonyms	Ethyl (diethoxymethyl)phosphinate; Ethyl diethoxymethylphosphinate
IUPAC Name	diethoxymethyl-ethoxy-oxophosphanium
Molecular Weight	195.17
Molecular Formula	C7H16O4P+
InChI	ZKNJRUPWSFSOFM-UHFFFAOYSA-N
InChI Key	InChI=1S/C7H16O4P/c1-4-9-7(10-5-2)12(8)11-6-3/h7H,4-6H2,1-3H3/q+1
Boiling Point	224 °C
Flash Point	107 °C
Appearance	Solid
Isomeric SMILES	CCOC(OCC)[P+](=O)OCC

Q&A

What is the CAS number of Phosphinic acid, (diethoxymethyl)-, ethyl ester?

CAS number: 65600-74-0

What is the Canonical SMILES of Phosphinic acid, (diethoxymethyl)-, ethyl ester?

Canonical SMILES: CCOC(OCC)[P+](=O)OCC

What is the IUPAC Name of Phosphinic acid, (diethoxymethyl)-, ethyl ester?

IUPAC Name: diethoxymethyl-ethoxy-oxophosphanium

What is the molecular formula of Phosphinic acid, (diethoxymethyl)-, ethyl ester?

Molecular Formula: C7H16O4P+

What is the exact mass of Phosphinic acid, (diethoxymethyl)-, ethyl ester?

Exact Mass: 195.07862099

How many hydrogen bond acceptors does Phosphinic acid, (diethoxymethyl)-, ethyl ester have?

Computed Properties Hydrogen Bond Acceptor Count: 4

How many rotatable bonds does Phosphinic acid, (diethoxymethyl)-, ethyl ester have?

Computed Properties Rotatable Bond Count: 7

What is the XLogP3 value of Phosphinic acid, (diethoxymethyl)-, ethyl ester?

Computed Properties XLogP3: 0.5

What is the monoisotopic mass of Phosphinic acid, (diethoxymethyl)-, ethyl ester?

Monoisotopic Mass: 195.07862099

What are some of the synonyms for Phosphinic acid, (diethoxymethyl)-, ethyl ester provided by the depositor?

Depositor-Supplied Synonyms: Ethyl (diethoxymethyl)phosphinate, diethoxymethyl-ethoxy-oxophosphanium, ethyl diethoxymethylphosphinate, ethyl(diethoxymethyl)phosphinate, Phosphinic acid, (diethoxymethyl)-, ethyl ester, etc.