Phosphine oxide,bis(4-methoxyphenyl)-

Catalog Number	ACM15754515-1
CAS	15754-51-5
Structure
Synonyms	Bis(4-methoxyphenyl)phosphine oxide
IUPAC Name	bis(4-methoxyphenyl)-oxophosphanium
Molecular Weight	262.24
Molecular Formula	C14H15O3P
InChI	RREGWFNURZJKNB-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H14O3P/c1-16-11-3-7-13(8-4-11)18(15)14-9-5-12(17-2)6-10-14/h3-10H,1-2H3/q+1
Boiling Point	401.0±55.0 °C(Predicted)
Melting Point	124-125 °C
Appearance	Solid
Isomeric SMILES	COC1=CC=C(C=C1)[P+](=O)C2=CC=C(C=C2)OC

Q&A

What is the CAS number of Phosphine oxide,bis(4-methoxyphenyl)-?

The CAS number is 15754-51-5.

What is the Canonical SMILES of Phosphine oxide,bis(4-methoxyphenyl)-?

The Canonical SMILES is COC1=CC=C(C=C1)[P+](=O)C2=CC=C(C=C2)OC.

How many Heavy Atom Counts are in Phosphine oxide,bis(4-methoxyphenyl)-?

There are 18 Heavy Atoms in Phosphine oxide,bis(4-methoxyphenyl)-.

What is the Molecular Weight of Phosphine oxide,bis(4-methoxyphenyl)-?

The Molecular Weight is 261.23g/mol.

What is the InChIKey of Phosphine oxide,bis(4-methoxyphenyl)-?

The InChIKey is RREGWFNURZJKNB-UHFFFAOYSA-N.

How many Hydrogen Bond Acceptor Counts are in Phosphine oxide,bis(4-methoxyphenyl)-?

There are 3 Hydrogen Bond Acceptor Counts.

What is the IUPAC Name of Phosphine oxide,bis(4-methoxyphenyl)-?

The IUPAC Name is bis(4-methoxyphenyl)-oxophosphanium.

What is the Monoisotopic Mass of Phosphine oxide,bis(4-methoxyphenyl)-?

The Monoisotopic Mass is 261.06805630.

How many Rotatable Bond Counts are in Phosphine oxide,bis(4-methoxyphenyl)-?

There are 4 Rotatable Bond Counts.

What is the Exact Mass of Phosphine oxide,bis(4-methoxyphenyl)-?

The Exact Mass is 261.06805630.