Phosphine oxide, bis(3-methylphenyl)

Catalog Number	ACM145290342-1
CAS	145290-34-2
Structure
Synonyms	Bis(3-methylphenyl)phosphine oxide; Bis(3-methylphenyl)-oxophosphanium; Bis(m-tolyl)phosphine oxide
IUPAC Name	bis(3-methylphenyl)-oxophosphanium
Molecular Weight	230.24
Molecular Formula	C14H15OP
InChI	VLGBGPBIXWIGOS-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H14OP/c1-11-5-3-7-13(9-11)16(15)14-8-4-6-12(2)10-14/h3-10H,1-2H3/q+1
Boiling Point	374.4±45.0 °C(Predicted)
Purity	98%
Isomeric SMILES	CC1=CC(=CC=C1)[P+](=O)C2=CC=CC(=C2)C

Q&A

What is the chemical structure of Phosphine oxide, bis(3-methylphenyl)?

The chemical structure of Phosphine oxide, bis(3-methylphenyl) is CC1=CC(=CC=C1)[P+](=O)C2=CC=CC(=C2)C.

What is the InChI of Phosphine oxide, bis(3-methylphenyl)?

The InChI of Phosphine oxide, bis(3-methylphenyl) is InChI=1S/C14H14OP/c1-11-5-3-7-13(9-11)16(15)14-8-4-6-12(2)10-14/h3-10H,1-2H3/q+1.

What is the PubChem CID of Phosphine oxide, bis(3-methylphenyl)?

The PubChem CID of Phosphine oxide, bis(3-methylphenyl) is 15751684.

What is the IUPAC name of Phosphine oxide, bis(3-methylphenyl)?

The IUPAC name of Phosphine oxide, bis(3-methylphenyl) is bis(3-methylphenyl)-oxophosphanium.

What is the molecular weight of Phosphine oxide, bis(3-methylphenyl)?

The molecular weight of Phosphine oxide, bis(3-methylphenyl) is 229.23g/mol.

How many heavy atoms are present in Phosphine oxide, bis(3-methylphenyl)?

There are 16 heavy atoms present in Phosphine oxide, bis(3-methylphenyl).

What is the Canonical SMILES representation of Phosphine oxide, bis(3-methylphenyl)?

The Canonical SMILES representation of Phosphine oxide, bis(3-methylphenyl) is CC1=CC(=CC=C1)[P+](=O)C2=CC=CC(=C2)C.

What is the XLogP3 value of Phosphine oxide, bis(3-methylphenyl)?

The XLogP3 value of Phosphine oxide, bis(3-methylphenyl) is 3.2.

How many rotatable bonds are present in Phosphine oxide, bis(3-methylphenyl)?

There are 2 rotatable bonds present in Phosphine oxide, bis(3-methylphenyl).

What is the exact mass of Phosphine oxide, bis(3-methylphenyl)?

The exact mass of Phosphine oxide, bis(3-methylphenyl) is 229.078227064.