Phosphine oxide, bis(3,5-dimethylphenyl)-

Catalog Number	ACM187344929-1
CAS	187344-92-9
Structure
Synonyms	Bis(3,5-dimethylphenyl)phosphine oxide
IUPAC Name	bis(3,5-dimethylphenyl)-oxophosphanium
Molecular Weight	258.30
Molecular Formula	C16H19OP
InChI	LMXRTXPFJNGAAX-UHFFFAOYSA-N
InChI Key	InChI=1S/C16H18OP/c1-11-5-12(2)8-15(7-11)18(17)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3/q+1
Boiling Point	414.8±55.0 °C(Predicted)
Melting Point	82-84 °C
Purity	98%+
Appearance	Solid
Isomeric SMILES	CC1=CC(=CC(=C1)[P+](=O)C2=CC(=CC(=C2)C)C)C

Q&A

What is the CAS number of the compound bis(3,5-dimethylphenyl)phosphine oxide?

The CAS number is 187344-92-9.

What is the exact mass of bis(3,5-dimethylphenyl)phosphine oxide?

The exact mass is 257.109527191.

What is the molecular formula of bis(3,5-dimethylphenyl)phosphine oxide?

The molecular formula is C16H18OP+.

What is the molecular weight of bis(3,5-dimethylphenyl)phosphine oxide?

The molecular weight is 257.29g/mol.

How many heavy atoms are present in the molecule of bis(3,5-dimethylphenyl)phosphine oxide?

There are 18 heavy atoms.

Does bis(3,5-dimethylphenyl)phosphine oxide have any defined atom stereocenters?

No, it does not have any defined atom stereocenters.

How many rotatable bond counts are there in bis(3,5-dimethylphenyl)phosphine oxide?

There are 2 rotatable bond counts.

What is the computational property XLogP3 for bis(3,5-dimethylphenyl)phosphine oxide?

The XLogP3 value is 3.9.

What is the IUPAC name for bis(3,5-dimethylphenyl)phosphine oxide?

The IUPAC name is bis(3,5-dimethylphenyl)-oxophosphanium.

What are some of the depositor-supplied synonyms for bis(3,5-dimethylphenyl)phosphine oxide?

Some of the synonyms include BIS(3,5-DIMETHYLPHENYL)PHOSPHINE OXIDE, (XYL)2P(O)H, and Phosphine oxide, bis(3,5-dimethylphenyl)-.