Phosphine, dicyclohexyl(1,1-dimethylethyl)-, tetrafluoroborate(1-) (1:1)

Catalog Number	ACM1327162479
CAS	1327162-47-9
Synonyms	Tert-butyldicyclohexylphosphine tetrafluoroborate
IUPAC Name	tert-butyl(dicyclohexyl)phosphane;tetrafluoroborate
Molecular Weight	341.20
Molecular Formula	C16H31BF4P
InChI	XOMLPCCNVCCMRG-UHFFFAOYSA-N
InChI Key	InChI=1S/C16H31P.BF4/c1-16(2,3)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15;2-1(3,4)5/h14-15H,4-13H2,1-3H3;/q;-1
Isomeric SMILES	[B-](F)(F)(F)F.CC(C)(C)P(C1CCCCC1)C2CCCCC2

Q&A

What is the exact mass of the compound phosphine, dicyclohexyl(1,1-dimethylethyl)-, tetrafluoroborate?

The exact mass is 341.2192558

How many hydrogen bond acceptor counts are there in the compound?

There are 5 hydrogen bond acceptor counts.

What is the molecular weight of phosphine, dicyclohexyl(1,1-dimethylethyl)-, tetrafluoroborate?

The molecular weight is 341.2g/mol.

What is the IUPAC name of the compound?

The IUPAC name is tert-butyl(dicyclohexyl)phosphane;tetrafluoroborate.

How many covalently-bonded units are there in the compound?

There are 2 covalently-bonded units.

What is the canonical SMILES representation of the compound?

[B-](F)(F)(F)F.CC(C)(C)P(C1CCCCC1)C2CCCCC2

What is the InChI key of the compound?

XOMLPCCNVCCMRG-UHFFFAOYSA-N

What are the depositor-supplied synonyms for the compound?

1327162-47-9, Phosphine, dicyclohexyl(1,1-dimethylethyl)-, tetrafluoroborate

How many hydrogen bond donor counts are there in the compound?

There are 0 hydrogen bond donor counts.

What is the topological polar surface area of the compound?

The topological polar surface area is 0.