Phosphine, bis(4-methylphenyl)-

Catalog Number	ACM1017603-1
CAS	1017-60-3
Structure
Synonyms	Di-p-tolylphosphine; Bis(4-methylphenyl)phosphane; Bis(4-methylphenyl)phosphine
IUPAC Name	bis(4-methylphenyl)phosphane
Molecular Weight	214.24
Molecular Formula	C14H15P
InChI	RRSCGNXXNRAXJC-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H15P/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14/h3-10,15H,1-2H3
Boiling Point	122-124 °C
Purity	98%
Appearance	Liquid
Isomeric SMILES	CC1=CC=C(C=C1)PC2=CC=C(C=C2)C

Q&A

What is the IUPAC name of Phosphine, bis(4-methylphenyl)-?

The IUPAC name of Phosphine, bis(4-methylphenyl)- is bis(4-methylphenyl)-phenylphosphane.

What is the molecular formula of Phosphine, bis(4-methylphenyl)-?

The molecular formula of Phosphine, bis(4-methylphenyl)- is C20H19P.

What is the exact mass of Phosphine, bis(4-methylphenyl)-?

The exact mass of Phosphine, bis(4-methylphenyl)- is 290.122437604 g/mol.

What is the Monoisotopic Mass of Phosphine, bis(4-methylphenyl)-?

The Monoisotopic Mass of Phosphine, bis(4-methylphenyl)- is 290.122437604.

How many heavy atoms are present in Phosphine, bis(4-methylphenyl)-?

There are 21 heavy atoms in Phosphine, bis(4-methylphenyl)-.

How many rotatable bonds are present in Phosphine, bis(4-methylphenyl)-?

There are 3 rotatable bonds in Phosphine, bis(4-methylphenyl)-.

Does Phosphine, bis(4-methylphenyl)- have any defined atom stereocenters?

No, Phosphine, bis(4-methylphenyl)- does not have any defined atom stereocenters.

What is the Canonical SMILES of Phosphine, bis(4-methylphenyl)-?

The Canonical SMILES of Phosphine, bis(4-methylphenyl)- is CC1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=C(C=C3)C.

What is the InChIKey of Phosphine, bis(4-methylphenyl)-?

The InChIKey of Phosphine, bis(4-methylphenyl)- is VPEPTFVFITUGAD-UHFFFAOYSA-N.

What are some of the Depositor-Supplied Synonyms for Phosphine, bis(4-methylphenyl)-?

Some of the Depositor-Supplied Synonyms for Phosphine, bis(4-methylphenyl)- are bis(4-methylphenyl)-phenylphosphane, phenyldi-p-tolylphosphine, and NSC116686.