Phosphinane 1-oxide

Catalog Number	ACM890651124
CAS	890651-12-4
Synonyms	1-Oxophosphinan-1-Ium; Hexahydrophosphinine Oxide
IUPAC Name	phosphinan-1-ium 1-oxide
Molecular Weight	118.11
Molecular Formula	C5H11OP
InChI	MFTKMJCLNKMCEL-UHFFFAOYSA-N
InChI Key	InChI=1S/C5H10OP/c6-7-4-2-1-3-5-7/h1-5H2/q+1
Purity	98%
Isomeric SMILES	C1CC[P+](=O)CC1

Q&A

What is the CAS number of Phosphinane 1-oxide?

The CAS number of Phosphinane 1-oxide is 4963-95-5.

What is the Canonical SMILES of Phosphinane 1-oxide?

The Canonical SMILES of Phosphinane 1-oxide is C1CCP(=O)(CC1)C2=CC=CC=C2.

How many heavy atoms are present in Phosphinane 1-oxide?

There are 13 heavy atoms present in Phosphinane 1-oxide.

What is the XLogP3 value for Phosphinane 1-oxide?

The XLogP3 value for Phosphinane 1-oxide is 1.8.

What is the IUPAC Name of Phosphinane 1-oxide?

The IUPAC Name of Phosphinane 1-oxide is 1-phenyl-1λ5-phosphinane 1-oxide.

What is the molecular weight of Phosphinane 1-oxide?

The molecular weight of Phosphinane 1-oxide is 194.21g/mol.

What is the Monoisotopic Mass of Phosphinane 1-oxide?

The Monoisotopic Mass of Phosphinane 1-oxide is 194.086052095.

What is the InChIKey of Phosphinane 1-oxide?

The InChIKey of Phosphinane 1-oxide is IDMWCMSMIDBTLE-UHFFFAOYSA-N.

How many hydrogen bond acceptors are present in Phosphinane 1-oxide?

There is 1 hydrogen bond acceptor present in Phosphinane 1-oxide.

What is the NSC Number of Phosphinane 1-oxide?

The NSC Number of Phosphinane 1-oxide is 616253.