Phenyltrichlorogermane

Catalog Number	ACM1074299-1
CAS	1074-29-9
Structure
Synonyms	Trichlorophenylgermane
IUPAC Name	trichloro(phenyl)germane
Molecular Weight	256.1
Molecular Formula	C6H5Cl3Ge
Canonical SMILES	C1=CC=C(C=C1)[Ge](Cl)(Cl)Cl
InChI	InChI=1S/C6H5Cl3Ge/c7-10(8,9)6-4-2-1-3-5-6/h1-5H
InChI Key	CIWQSBMDFPABPQ-UHFFFAOYSA-N
Melting Point	<0 °C
Purity	98%
Appearance	Solid
Complexity	104
Covalently-Bonded Unit Count	1
EC Number	214-039-8
Exact Mass	255.866861
Formal Charge	0
Heavy Atom Count	10
Hydrogen Bond Acceptor Count	0
Hydrogen Bond Donor Count	0
Monoisotopic Mass	255.866861
Rotatable Bond Count	0
Topological Polar Surface Area	0

Q&A

What is the molecular formula of Phenyltrichlorogermane?

The molecular formula of Phenyltrichlorogermane is C6H5Cl3Ge.

What is the molecular weight of Phenyltrichlorogermane?

The molecular weight of Phenyltrichlorogermane is 256.1 g/mol.

What is the IUPAC name of Phenyltrichlorogermane?

The IUPAC name of Phenyltrichlorogermane is trichloro(phenyl)germane.

What is the InChI of Phenyltrichlorogermane?

The InChI of Phenyltrichlorogermane is InChI=1S/C6H5Cl3Ge/c7-10(8,9)6-4-2-1-3-5-6/h1-5H.

What is the InChIKey of Phenyltrichlorogermane?

The InChIKey of Phenyltrichlorogermane is CIWQSBMDFPABPQ-UHFFFAOYSA-N.

What is the canonical SMILES of Phenyltrichlorogermane?

The canonical SMILES of Phenyltrichlorogermane is C1=CC=C(C=C1)[Ge](Cl)(Cl)Cl.

What is the CAS number of Phenyltrichlorogermane?

The CAS number of Phenyltrichlorogermane is 1074-29-9.

What is the EC number of Phenyltrichlorogermane?

The EC number of Phenyltrichlorogermane is 214-039-8.

How many heavy atoms are there in Phenyltrichlorogermane?

There are 10 heavy atoms in Phenyltrichlorogermane.

Is Phenyltrichlorogermane a canonicalized compound?

Yes, Phenyltrichlorogermane is a canonicalized compound.