2-Phenylpyridine-4-carboxylic acid

Catalog Number	ACM55240512-2
CAS	55240-51-2
Structure
Synonyms	2-Phenylisonicotinic Acid; 2-Phenylpyridine-4-Carboxylic Acid
IUPAC Name	2-phenylpyridine-4-carboxylic acid
Molecular Weight	199.21
Molecular Formula	C12H9NO2
Canonical SMILES	C1=CC=C(C=C1)C2=NC=CC(=C2)C(=O)O
InChI	OMMKWOVBOKXXQU-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H9NO2/c14-12(15)10-6-7-13-11(8-10)9-4-2-1-3-5-9/h1-8H,(H,14,15)
Melting Point	270-271 °C
Purity	98%+
Appearance	Solid
Complexity	224
Covalently-Bonded Unit Count	1
Exact Mass	199.063329g/mol
Formal Charge	0
Heavy Atom Count	15
Isomeric SMILES	C1=CC=C(C=C1)C2=NC=CC(=C2)C(=O)O
Monoisotopic Mass	199.063329g/mol
Rotatable Bond Count	2

Q&A

What is the chemical formula of 2-Phenylpyridine-4-carboxylic acid?

The chemical formula is C12H9NO2.

What is the molecular weight of 2-Phenylpyridine-4-carboxylic acid?

The molecular weight is 199.21.

What are some of the product categories that 2-Phenylpyridine-4-carboxylic acid belongs to?

Carboxylic Acids, Pyridines, API intermediates.

What is another name for 2-Phenylpyridine-4-carboxylic acid?

2-PHENYL-ISONICOTINIC ACID.

What is the melting point of 2-Phenylpyridine-4-carboxylic acid?

The melting point is 270-271 °C.

What is the density of 2-Phenylpyridine-4-carboxylic acid?

The density is 1.241±0.06 g/cm3.

What is the form of 2-Phenylpyridine-4-carboxylic acid?

It is a powder to crystal.

What is the color of 2-Phenylpyridine-4-carboxylic acid?

The color is White to Orange to Green.

What is the storage temperature recommended for 2-Phenylpyridine-4-carboxylic acid?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What are the hazard codes associated with 2-Phenylpyridine-4-carboxylic acid?

The hazard codes are Xi,Xn.