6-Phenylpyridine-3-carboxylic acid

Catalog Number	ACM29051443-1
CAS	29051-44-3
Structure
Synonyms	3-Pyridinecarboxylic Acid
IUPAC Name	6-phenylpyridine-3-carboxylic acid
Molecular Weight	199.21
Molecular Formula	C12H9NO2
Canonical SMILES	C1=CC=C(C=C1)C2=NC=C(C=C2)C(=O)O
InChI	DLFLQXUYRFIFOK-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H9NO2/c14-12(15)10-6-7-11(13-8-10)9-4-2-1-3-5-9/h1-8H,(H,14,15)
Melting Point	243 °C
Purity	98%+
Appearance	Solid
Complexity	224
Covalently-Bonded Unit Count	1
EC Number	249-386-4
Exact Mass	199.063329g/mol
Formal Charge	0
Heavy Atom Count	15
Isomeric SMILES	C1=CC=C(C=C1)C2=NC=C(C=C2)C(=O)O
Monoisotopic Mass	199.063329g/mol
Rotatable Bond Count	2

Q&A

What is the molecular weight of 6-Phenylpyridine-3-carboxylic acid?

The molecular weight is 199.21.

What are the product categories that 6-Phenylpyridine-3-carboxylic acid falls into?

The product categories are Pyridine series, Carboxylic Acids, Pyridines, and Carboxylic Acids.

What is another name for 6-Phenylpyridine-3-carboxylic acid?

It is also known as 6-PHENYLNICOTINIC ACID.

What is the melting point of 6-Phenylpyridine-3-carboxylic acid?

The melting point is 243 °C.

What is the predicted density of 6-Phenylpyridine-3-carboxylic acid?

The predicted density is 1.241±0.06 g/cm3.

What form does 6-Phenylpyridine-3-carboxylic acid come in?

It comes in powder to crystal form.

What is the color of 6-Phenylpyridine-3-carboxylic acid?

The color is White to Light yellow.

What is the predicted boiling point of 6-Phenylpyridine-3-carboxylic acid?

The predicted boiling point is 388.1±30.0 °C.

What is the hazard note associated with 6-Phenylpyridine-3-carboxylic acid?

The hazard note is Harmful.

What is the pKa value of 6-Phenylpyridine-3-carboxylic acid?

The predicted pKa value is 2.19±0.10.