2-Phenylnicotinic acid

Catalog Number	ACM33421395-2
CAS	33421-39-5
Structure
Synonyms	2-Phenylpyridine-3-carboxylic Acid
IUPAC Name	2-phenylpyridine-3-carboxylic acid
Molecular Weight	199.21
Molecular Formula	C12H9NO2
InChI	VLQVAEFYIADOKI-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H9NO2/c14-12(15)10-7-4-8-13-11(10)9-5-2-1-3-6-9/h1-8H,(H,14,15)
Melting Point	169 °C
Purity	98%+
Appearance	Solid
Isomeric SMILES	C1=CC=C(C=C1)C2=C(C=CC=N2)C(=O)O

Q&A

What is the molecular weight of 2-Phenylnicotinic acid?

The molecular weight of 2-Phenylnicotinic acid is 199.21.

What are the product categories that 2-Phenylnicotinic acid falls under?

2-Phenylnicotinic acid falls under Carboxylic Acids, Pyridines, and API intermediates.

What are some synonyms for 2-Phenylnicotinic acid?

Some synonyms for 2-Phenylnicotinic acid include 2-PHENYLPYRIDINE-3-CARBOXYLIC ACID, 2-PHENYL-3-PYRIDINECARBOXYLIC ACID, and 2-Phenylpyridin-3ylcarboxylic acid.

What is the melting point of 2-Phenylnicotinic acid?

The melting point of 2-Phenylnicotinic acid is 169 °C.

What is the density of 2-Phenylnicotinic acid?

The density of 2-Phenylnicotinic acid is 1.241±0.06 g/cm3 (Predicted).

What is the solubility of 2-Phenylnicotinic acid in acetonitrile, DMSO, and methanol?

2-Phenylnicotinic acid is slightly soluble in acetonitrile and DMSO, and sparingly soluble in methanol.

What is the pka of 2-Phenylnicotinic acid?

The pka of 2-Phenylnicotinic acid is 1.46±0.10 (Predicted).

What is the boiling point of 2-Phenylnicotinic acid?

The boiling point of 2-Phenylnicotinic acid is 357.3±22.0 °C (Predicted).

How should 2-Phenylnicotinic acid be stored?

2-Phenylnicotinic acid should be stored in an inert atmosphere at room temperature.

What is the hazard note associated with 2-Phenylnicotinic acid?

The hazard note associated with 2-Phenylnicotinic acid is that it is an irritant.