1,10-Phenanthroline-2-carbonitrile

Catalog Number	ACM1082195
CAS	1082-19-5
Structure
Synonyms	2-Cyano-1,10-phenanthroline
IUPAC Name	1,10-phenanthroline-2-carbonitrile
Molecular Weight	205.22
Molecular Formula	C13H7N3
InChI	LSMQCFPLQFCYAW-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H7N3/c14-8-11-6-5-10-4-3-9-2-1-7-15-12(9)13(10)16-11/h1-7H
Boiling Point	445.3±25.0 °C(Predicted)
Melting Point	241 °C
Purity	98%
Isomeric SMILES	C1=CC2=C(C3=C(C=C2)C=CC(=N3)C#N)N=C1

Q&A

What is the CAS number of 1,10-Phenanthroline-2-carbonitrile?

The CAS number of 1,10-Phenanthroline-2-carbonitrile is 1082-19-5.

What is the molecular weight of 1,10-Phenanthroline-2-carbonitrile?

The molecular weight of 1,10-Phenanthroline-2-carbonitrile is 205.21.

What are the synonyms of 1,10-Phenanthroline-2-carbonitrile?

The synonyms of 1,10-Phenanthroline-2-carbonitrile are 2-cyano-1,10-phenanthroline and 1,10-Phenanthroline-2-carbonitrile.

What is the molecular formula of 1,10-Phenanthroline-2-carbonitrile?

The molecular formula of 1,10-Phenanthroline-2-carbonitrile is C13H7N3.

What is the melting point of 1,10-Phenanthroline-2-carbonitrile in ethanol?

The melting point of 1,10-Phenanthroline-2-carbonitrile in ethanol is 241℃.

What is the density of 1,10-Phenanthroline-2-carbonitrile at 20 ºC and 760 Torr?

The density of 1,10-Phenanthroline-2-carbonitrile at 20 ºC and 760 Torr is 1.33±0.1 g/cm3.

What is the pKa value of 1,10-Phenanthroline-2-carbonitrile?

The pKa value of 1,10-Phenanthroline-2-carbonitrile is 4.00±0.10 (Predicted).

What is the predicted boiling point of 1,10-Phenanthroline-2-carbonitrile?

The predicted boiling point of 1,10-Phenanthroline-2-carbonitrile is 445.3±25.0 °C.

How should 1,10-Phenanthroline-2-carbonitrile be stored?

1,10-Phenanthroline-2-carbonitrile should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the chemical name of 1,10-Phenanthroline-2-carbonitrile?

The chemical name of 1,10-Phenanthroline-2-carbonitrile is 2-cyano-1,10-phenanthroline.