1,10-Phenanthrolin-5-amine

Catalog Number	ACM54258412-2
CAS	54258-41-2
Structure
Synonyms	5-Amino-1,10-phenanthroline
IUPAC Name	1,10-phenanthrolin-5-amine
Molecular Weight	195.22
Molecular Formula	C12H9N3
Canonical SMILES	C1=CC2=CC(=C3C=CC=NC3=C2N=C1)N
InChI	DKPSSMOJHLISJI-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H9N3/c13-10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-7H,13H2
Boiling Point	441.1 °C at 760 mmHg
Melting Point	254-258 °C -lit.
Purity	98%
Appearance	Brown to orange solid
Complexity	231
Covalently-Bonded Unit Count	1
Exact Mass	195.079647300
Formal Charge	0
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	195.079647300
Rotatable Bond Count	0
Topological Polar Surface Area	51.8 Ų

Q&A

What is the molecular weight of 1,10-Phenanthrolin-5-amine?

The molecular weight is 195.22.

What are the product categories that 1,10-Phenanthrolin-5-amine falls under?

Electronic Chemicals, Amines, Aromatics, Fluorescent Labels & Indicators, Heterocycles.

What is the melting point of 1,10-Phenanthrolin-5-amine?

The melting point is 254-258 °C.

What is the predicted density of 1,10-Phenanthrolin-5-amine?

The predicted density is 1.333±0.06 g/cm3.

What is the solubility of 1,10-Phenanthrolin-5-amine?

It is sparingly soluble in DMSO and Methanol.

What is the boiling point of 1,10-Phenanthrolin-5-amine?

The boiling point is 197-198 °C.

What are the safety statements associated with 1,10-Phenanthrolin-5-amine?

Safety Statements: 26-36/37/39.

What are the risk statements associated with 1,10-Phenanthrolin-5-amine?

Risk Statements: 22-41-43.

What are some uses of 1,10-Phenanthrolin-5-amine?

It is used as a potential fluorescent label for DNA detection, as a mediator for glucose oxidase for biosensors and biofuel cells, and in the synthesis of bis-[1,10]phenanthrolin-5-yl-pyromellitic diimide (Bphen-PMD) for organic light-emitting devices.

What color is 1,10-Phenanthrolin-5-amine?

It ranges from yellow to orange in color.