Pentamethylcyclopentadienylrhenium tricarbonyl

Catalog Number	ACM12130880-1
CAS	12130-88-0
Structure
Synonyms	Carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhenium
Molecular Weight	405.46
Molecular Formula	C13H15O3Re
Canonical SMILES	CC1=C([C](C(=C1C)C)C)C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Re]
InChI	InChI=1S/C10H15.3CO.Re/c1-6-7(2)9(4)10(5)8(6)3;3*1-2;/h1-5H3;
InChI Key	RMZUPTPNMRTTKD-UHFFFAOYSA-N
Melting Point	149-151 °C
Purity	95%+
Appearance	Off-white powder
Storage	Store below +20 °C
Complexity	151
Covalently-Bonded Unit Count	5
Defined Atom Stereocenter Count	0
Exact Mass	406.057872
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Monoisotopic Mass	406.057872
Rotatable Bond Count	0
Topological Polar Surface Area	3 Ų

Q&A

What is the molecular weight of Pentamethylcyclopentadienylrhenium tricarbonyl?

The molecular weight is 405.47.

What are the product categories that Pentamethylcyclopentadienylrhenium tricarbonyl belongs to?

It belongs to metal carbonyl complexes.

What are some synonyms for Pentamethylcyclopentadienylrhenium tricarbonyl?

Some synonyms include "PENTAMETHYLCYCLOPENTADIENYLRHENIUM TRICARBONYL" and "Pentamethylcyclopentadienylrhenium tricarbonyl, min. 98%".

What is the melting point of Pentamethylcyclopentadienylrhenium tricarbonyl?

The melting point is 149-151°C.

What is the color of Pentamethylcyclopentadienylrhenium tricarbonyl?

The color is off-white.

In what form is Pentamethylcyclopentadienylrhenium tricarbonyl found?

It is found in the form of powder.

What is the chemical formula of Pentamethylcyclopentadienylrhenium tricarbonyl?

The chemical formula is C13H15O3Re.

What are some safety statements associated with Pentamethylcyclopentadienylrhenium tricarbonyl?

Safety statements 24/25 are associated with it.