(Pentafluoroethyl)diphenylphosphine

Catalog Number	ACM20157748-1
CAS	20157-74-8
Structure
Synonyms	1,1,2,2,2-Pentafluoroethyl(Diphenyl)Phosphane
IUPAC Name	1,1,2,2,2-pentafluoroethyl(diphenyl)phosphane
Molecular Weight	304.20
Molecular Formula	C14H10F5P
InChI	PEVPYFJDZKYVEE-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H10F5P/c15-13(16,17)14(18,19)20(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H
Purity	98%
Isomeric SMILES	C1=CC=C(C=C1)P(C2=CC=CC=C2)C(C(F)(F)F)(F)F

Q&A

What is the molecular formula of (Pentafluoroethyl)diphenylphosphine?

The molecular formula is C14H10F5P.

What is the exact mass of (Pentafluoroethyl)diphenylphosphine?

The exact mass is 304.04402813.

What is the IUPAC name of (Pentafluoroethyl)diphenylphosphine?

The IUPAC name is 1,1,2,2,2-pentafluoroethyl(diphenyl)phosphane.

How many hydrogen bond acceptor counts are there in (Pentafluoroethyl)diphenylphosphine?

There are 5 hydrogen bond acceptor counts.

What is the XLogP3 value of (Pentafluoroethyl)diphenylphosphine?

The XLogP3 value is 4.9.

What is the CAS number of (Pentafluoroethyl)diphenylphosphine?

The CAS number is 20157-74-8.

How many computed properties defined atom stereocenter count are there in (Pentafluoroethyl)diphenylphosphine?

There are 0 computed properties defined atom stereocenter counts.

What is the canonical SMILES of (Pentafluoroethyl)diphenylphosphine?

The canonical SMILES is C1=CC=C(C=C1)P(C2=CC=CC=C2)C(C(F)(F)F)(F)F.

What is the computed properties heavy atom count of (Pentafluoroethyl)diphenylphosphine?

The computed properties heavy atom count is 20.

What is the molecular weight of (Pentafluoroethyl)diphenylphosphine?

The molecular weight is 304.19g/mol.