ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

P-Tolyldiphenylphosphine

Catalog Number ACM1031932-1
CAS 1031-93-2
Structure P-Tolyldiphenylphosphine
Synonyms (4-Methylphenyl)Diphenyl Phosphine; Diphenyl(P-Tolyl)Phosphine
IUPAC Name (4-methylphenyl)-diphenylphosphane
Molecular Weight 276.32
Molecular Formula C19H17P
InChI QJIMTLTYXBDJFC-UHFFFAOYSA-N
InChI Key InChI=1S/C19H17P/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15H,1H3
Boiling Point 250 °C(Press: 14 Torr)
Melting Point 66-68 °C(lit.)
Purity 98%
Appearance Solid
Isomeric SMILES CC1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3
Q&A

What is the chemical name of Diphenyl(p-tolyl)phosphine?

The chemical name of the compound is Diphenyl(p-tolyl)phosphine.

What is the CAS number of Diphenyl(p-tolyl)phosphine?

The CAS number is 1031-93-2.

What is the molecular formula of Diphenyl(p-tolyl)phosphine?

The molecular formula is C19H17P.

What is the molecular weight of Diphenyl(p-tolyl)phosphine?

The molecular weight is 276.3g/mol.

How many heavy atoms are present in Diphenyl(p-tolyl)phosphine?

There are 20 heavy atoms present in the compound.

Does Diphenyl(p-tolyl)phosphine have any hydrogen bond acceptor counts?

No, it does not have any hydrogen bond acceptor counts.

What is the Canonical SMILES representation of Diphenyl(p-tolyl)phosphine?

The Canonical SMILES representation is CC1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.

What is the InChIKey for Diphenyl(p-tolyl)phosphine?

The InChIKey is QJIMTLTYXBDJFC-UHFFFAOYSA-N.

How many rotatable bond counts are there in Diphenyl(p-tolyl)phosphine?

There are 3 rotatable bond counts in the compound.

Please kindly note that our products and services are for research use only.