N3,N3-Dimethylbutane-1,3-diamine

Catalog Number	ACM60978338-2
CAS	60978-33-8
Structure
Synonyms	N-(3-Amino-1-Methylpropyl)-N,N-Dimethylamine; (3-Amino-1-Methylpropyl)Dimethylamine; 3-N,3-N-Dimethylbutane-1,3-Diamine
IUPAC Name	3-N,3-N-dimethylbutane-1,3-diamine
Molecular Weight	116.21
Molecular Formula	C6H16N2
InChI	HMNAAVUZNWPXDC-UHFFFAOYSA-N
InChI Key	InChI=1S/C6H16N2/c1-6(4-5-7)8(2)3/h6H,4-5,7H2,1-3H3
Purity	98%
Appearance	Liquid
Isomeric SMILES	CC(CCN)N(C)C

Q&A

What is the CAS number for N-(3-amino-1-methylpropyl)-N,N-dimethylamine?

The CAS number is 60978-33-8.

What is the molecular weight of N-(3-amino-1-methylpropyl)-N,N-dimethylamine?

The molecular weight is 116.2.

What are some synonyms for N-(3-amino-1-methylpropyl)-N,N-dimethylamine?

Some synonyms include Albb-004082, N3,N3-Dimethylbutane-1,3-diamine, and (4-aminobutan-2-yl)dimethylamine.

What is the chemical formula for N-(3-amino-1-methylpropyl)-N,N-dimethylamine?

The chemical formula is C6H16N2.

How should N-(3-amino-1-methylpropyl)-N,N-dimethylamine be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8 °C.

What hazard codes are associated with N-(3-amino-1-methylpropyl)-N,N-dimethylamine?

The hazard code is C.

What safety statements are recommended for handling N-(3-amino-1-methylpropyl)-N,N-dimethylamine?

Safety statements 26-36/37/39-45 are recommended.

What is the Risk Statement for N-(3-amino-1-methylpropyl)-N,N-dimethylamine?

The Risk Statements are 21/22-34-43.

What is the primary use of N-(3-amino-1-methylpropyl)-N,N-dimethylamine?

It is used in the preparation of Dihydropyrazolecarboxamide derivatives for the treatment of cancer and fibrosis.

Which country assigns WGK Germany rating of 3 for N-(3-amino-1-methylpropyl)-N,N-dimethylamine?

WGK Germany assigns it a rating of 3 for N-(3-amino-1-methylpropyl)-N,N-dimethylamine.