N2,N3-Di-tert-butylbutane-2,3-diamine

Catalog Number	ACM1167987076-1
CAS	1167987-07-6
Synonyms	N,N'-Di-t-butyl-2,3-diaminobutane
IUPAC Name	2-N,3-N-Ditert-butylbutane-2,3-diamine
Molecular Weight	200.36
Molecular Formula	C12H28N2
Canonical SMILES	CC(C(C)NC(C)(C)C)NC(C)(C)C
InChI	InChI=1S/C12H28N2/c1-9(13-11(3,4)5)10(2)14-12(6,7)8/h9-10,13-14H,1-8H3
InChI Key	KEPBYALUNVNGRN-UHFFFAOYSA-N
Boiling Point	224-232 °C
Flash Point	80-100 °F
Purity	95%+
Density	0.82 g/mL at 25 °C (lit.)
Appearance	Colorless liquid
Storage	Under inert gas (nitrogen or Argon) at 2-8 °C
Complexity	142
Exact Mass	200.225248902
Heavy Atom Count	14
Isomeric SMILES	CC(C(C)NC(C)(C)C)NC(C)(C)C
Monoisotopic Mass	200.225248902
Topological Polar Surface Area	24.1 Ų

Q&A

What is the molecular weight of N2,N3-Di-tert-butylbutane-2,3-diamine?

The molecular weight is 200.36.

What are some synonyms for N2,N3-Di-tert-butylbutane-2,3-diamine?

Some synonyms include N,N'-Di-t-butyl-2,3-diaMinobutane and N,N''-Di-t-butyl-2,3-diaminobutane.

What is the boiling point of N2,N3-Di-tert-butylbutane-2,3-diamine?

The boiling point is 224-232°C.

What is the flash point of N2,N3-Di-tert-butylbutane-2,3-diamine?

The flash point is 80-100°F.

What is the predicted pka value of N2,N3-Di-tert-butylbutane-2,3-diamine?

The predicted pka value is 10.46±0.38.

What is the color of N2,N3-Di-tert-butylbutane-2,3-diamine?

The color is colorless and viscous.

What is the density of N2,N3-Di-tert-butylbutane-2,3-diamine?

The density is 0.82.

How should N2,N3-Di-tert-butylbutane-2,3-diamine be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8 °C.

In what form does N2,N3-Di-tert-butylbutane-2,3-diamine exist?

It exists in liquid form.

Is N2,N3-Di-tert-butylbutane-2,3-diamine air sensitive?

Yes, it is air sensitive.