N1,N2-Dimethyl-N1-(2-(methylamino)ethyl)ethane-1,2-diamine

Catalog Number	ACM105840-1
CAS	105-84-0
Structure
Synonyms	1,4,7-Trimethyldiethylenetriamine; N,N',N''-Trimethyldiethylenetriamine
IUPAC Name	N,N'-dimethyl-N'-[2-(methylamino)ethyl]ethane-1,2-diamine
Molecular Weight	145.25
Molecular Formula	C7H19N3
Canonical SMILES	CNCCN(C)CCNC
InChI	ODZZIKZQNODXFS-UHFFFAOYSA-N
InChI Key	InChI=1S/C7H19N3/c1-8-4-6-10(3)7-5-9-2/h8-9H,4-7H2,1-3H3
Boiling Point	190.3±8.0 °C at 760 mmHg
Purity	97%
Appearance	Pale yellow liduid
EC Number	203-337-3
Exact Mass	145.157897619
Heavy Atom Count	10
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Monoisotopic Mass	145.157897619
Rotatable Bond Count	6
Topological Polar Surface Area	27.3 Ų

Q&A

What is the chemical formula for N,N'-dimethyl-N-[2-(methylamino)ethyl]ethylenediamine?

The chemical formula is C7H19N3.

What is the molecular weight of N,N'-dimethyl-N-[2-(methylamino)ethyl]ethylenediamine?

The molecular weight is 145.25.

What are some synonyms for N,N'-dimethyl-N-[2-(methylamino)ethyl]ethylenediamine?

Some synonyms include 1,4,7-TRIMETHYLDIETHYLENETRIAMINE and Methylbis[2-(methylamino)ethyl]amine.

What is the Boiling point of N,N'-dimethyl-N-[2-(methylamino)ethyl]ethylenediamine?

The boiling point is 56°C/0.1mmHg.

What is the refractive index range for N,N'-dimethyl-N-[2-(methylamino)ethyl]ethylenediamine?

The refractive index range is 1.4500 to 1.4540.

What is the density of N,N'-dimethyl-N-[2-(methylamino)ethyl]ethylenediamine?

The density is 0.9135.

How should N,N'-dimethyl-N-[2-(methylamino)ethyl]ethylenediamine be stored?

It should be kept in a dark place, in an inert atmosphere, at room temperature.

Is N,N'-dimethyl-N-[2-(methylamino)ethyl]ethylenediamine classified as a hazardous substance?

Yes, it is classified as Hazard Class 8.

What is the EPA Substance Registry System number for N,N'-dimethyl-N-[2-(methylamino)ethyl]ethylenediamine?

The EPA Substance Registry System number is 105-84-0.

Does N,N'-dimethyl-N-[2-(methylamino)ethyl]ethylenediamine fall under the TSCA regulation?

Yes, it falls under TSCA (Toxic Substances Control Act) regulation.