N1,N2-Dimesitylethane-1,2-diamine

Catalog Number	ACM134030210-1
CAS	134030-21-0
Structure
Synonyms	N,N'-Bis(2,4,6-trimethylphenyl)ethylenediamine; N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine
IUPAC Name	N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine
Molecular Weight	296.45
Molecular Formula	C20H28N2
Canonical SMILES	CC1=CC(=C(C(=C1)C)NCCNC2=C(C=C(C=C2C)C)C)C
InChI	RQXQQXIIAQTDHU-UHFFFAOYSA-N
InChI Key	InChI=1S/C20H28N2/c1-13-9-15(3)19(16(4)10-13)21-7-8-22-20-17(5)11-14(2)12-18(20)6/h9-12,21-22H,7-8H2,1-6H3
Boiling Point	471.5±33.0 °C(Predicted)
Purity	97%
Complexity	274
Covalently-Bonded Unit Count	1
Exact Mass	296.225248902
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	296.225248902
Rotatable Bond Count	5
Topological Polar Surface Area	24.1 Ų

Q&A

What is the molecular weight of N1,N2-Dimesitylethane-1,2-diamine?

The molecular weight is 296.45.

What are some synonyms for N1,N2-Dimesitylethane-1,2-diamine?

Some synonyms include N,N'-Bis(2,4,6-trimethylphenyl)ethylenediamine and N,N'-Bis(2,4,6-trimethylphenyl)ethane-1,2-diamine.

What is the boiling point of N1,N2-Dimesitylethane-1,2-diamine?

The predicted boiling point is 471.5±33.0 °C.

How should N1,N2-Dimesitylethane-1,2-diamine be stored?

It should be kept in a dark place, in an inert atmosphere, and at room temperature.

What is the density of N1,N2-Dimesitylethane-1,2-diamine?

The density is 1.033.

What is the pKa value of N1,N2-Dimesitylethane-1,2-diamine?

The predicted pKa value is 5.28±0.50.

Can N1,N2-Dimesitylethane-1,2-diamine be stored in direct sunlight?

No, it should be kept in a dark place.

What is the chemical formula of N1,N2-Dimesitylethane-1,2-diamine?

The chemical formula is C20H28N2.

What is the recommended storage temperature for N1,N2-Dimesitylethane-1,2-diamine?

It should be stored at room temperature.

What is another name for N1,N2-Dimesitylethane-1,2-diamine that includes the term "ethanediamine"?

N,N'-Bis(2,4,6-trimethylphenyl)ethylenediamine is another name that includes the term "ethanediamine".